[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-[(4S)-4-hydroxycyclohexen-1-yl]acetyl]oxyoxan-2-yl]methyl 2-[(4S)-4-hydroxycyclohexen-1-yl]acetate
| Internal ID | 4f55eb0c-0026-4430-b277-da4ad8213af6 |
| Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-[(4S)-4-hydroxycyclohexen-1-yl]acetyl]oxyoxan-2-yl]methyl 2-[(4S)-4-hydroxycyclohexen-1-yl]acetate |
| SMILES (Canonical) | C1CC(=CCC1O)CC(=O)OCC2C(C(C(C(O2)OC(=O)CC3=CCC(CC3)O)O)O)O |
| SMILES (Isomeric) | C1CC(=CC[C@H]1O)CC(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)CC3=CC[C@H](CC3)O)O)O)O |
| InChI | InChI=1S/C22H32O10/c23-14-5-1-12(2-6-14)9-17(25)30-11-16-19(27)20(28)21(29)22(31-16)32-18(26)10-13-3-7-15(24)8-4-13/h1,3,14-16,19-24,27-29H,2,4-11H2/t14-,15-,16-,19-,20+,21-,22+/m1/s1 |
| InChI Key | DSTVWMFPWBECRJ-BMQHGUCVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H32O10 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19954721 g/mol |
| Topological Polar Surface Area (TPSA) | 163.00 Ų |
| XlogP | -1.30 |
| There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-[(4S)-4-hydroxycyclohexen-1-yl]acetyl]oxyoxan-2-yl]methyl 2-[(4S)-4-hydroxycyclohexen-1-yl]acetate](https://plantaedb.com/storage/docs/compounds/2023/11/d8d3fe20-8574-11ee-a62c-29364372b12f.jpg "2D Structure of [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-[(4S)-4-hydroxycyclohexen-1-yl]acetyl]oxyoxan-2-yl]methyl 2-[(4S)-4-hydroxycyclohexen-1-yl]acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.03% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.74% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.30% | 97.09% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.59% | 92.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.79% | 99.17% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.41% | 95.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.91% | 89.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.42% | 92.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.14% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.93% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Phyllanthus meghalayensis |
| PubChem | 21577091 |
| LOTUS | LTS0029565 |
| wikiData | Q104988029 |