methyl (3R,4R,4aR,6aR,6bS,8aR,12aR,14aR,14bR)-3-hydroxy-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4-carboxylate
Internal ID | c632b08e-8eba-4e7e-9434-e04a4344bd64 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | methyl (3R,4R,4aR,6aR,6bS,8aR,12aR,14aR,14bR)-3-hydroxy-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4-carboxylate |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C(=O)OC)O)C)C)C2C1)C)C)C |
SMILES (Isomeric) | C[C@@]12CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@H]([C@]5(C)C(=O)OC)O)C)C)[C@@H]1CC(CC2)(C)C)C |
InChI | InChI=1S/C31H50O3/c1-26(2)15-16-27(3)17-18-29(5)20(21(27)19-26)9-10-22-28(4)13-12-24(32)31(7,25(33)34-8)23(28)11-14-30(22,29)6/h9,21-24,32H,10-19H2,1-8H3/t21-,22+,23+,24+,27+,28+,29+,30+,31+/m0/s1 |
InChI Key | XICINIKFSAKUOG-JAUGCHRASA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H50O3 |
Molecular Weight | 470.70 g/mol |
Exact Mass | 470.37599545 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 8.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.13% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.84% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.32% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.96% | 96.77% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.75% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.99% | 97.09% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.37% | 93.03% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 85.54% | 85.30% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.23% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 85.13% | 98.95% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.64% | 91.07% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.33% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.11% | 94.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.80% | 95.56% |
CHEMBL5028 | O14672 | ADAM10 | 80.71% | 97.50% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.66% | 97.21% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.50% | 92.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.27% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Boswellia sacra |
PubChem | 162954930 |
LOTUS | LTS0156121 |
wikiData | Q105328410 |