[2-(4-hydroxyphenyl)-1-[[(2S)-3-(4-hydroxyphenyl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]propanoyl]amino]ethyl]phosphonic acid
| Internal ID | 8695f1ce-aec7-4869-8e4a-87241123c537 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | [2-(4-hydroxyphenyl)-1-[[(2S)-3-(4-hydroxyphenyl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]propanoyl]amino]ethyl]phosphonic acid |
| SMILES (Canonical) | CC(C)C(C(=O)NC(CC1=CC=C(C=C1)O)C(=O)NC(CC2=CC=C(C=C2)O)P(=O)(O)O)NC |
| SMILES (Isomeric) | CC(C)[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)NC(CC2=CC=C(C=C2)O)P(=O)(O)O)NC |
| InChI | InChI=1S/C23H32N3O7P/c1-14(2)21(24-3)23(30)25-19(12-15-4-8-17(27)9-5-15)22(29)26-20(34(31,32)33)13-16-6-10-18(28)11-7-16/h4-11,14,19-21,24,27-28H,12-13H2,1-3H3,(H,25,30)(H,26,29)(H2,31,32,33)/t19-,20?,21-/m0/s1 |
| InChI Key | AFAFFSSNAUKMNO-YSTUSHMSSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C23H32N3O7P |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.19778737 g/mol |
| Topological Polar Surface Area (TPSA) | 168.00 Ų |
| XlogP | -0.90 |
| 93768-49-1 |
| [2-(4-hydroxyphenyl)-1-[[(2S)-3-(4-hydroxyphenyl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]propanoyl]amino]ethyl]phosphonic acid |
| DTXSID20918133 |
| I5-B2 |
| AKOS040746910 |
| L-Tyrosinamide, N-methyl-L-valyl-N-(2-(4-hydroxyphenyl)-1-phosphonoethyl)- |
| N-[1-Hydroxy-3-(4-hydroxyphenyl)-1-{[2-(4-hydroxyphenyl)-1-phosphonoethyl]imino}propan-2-yl]-3-methyl-2-(methylamino)butanimidic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1808 | P12821 | Angiotensin-converting enzyme |
52 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.17% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 96.20% | 96.61% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.13% | 94.45% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 92.63% | 89.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.58% | 96.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 91.21% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 88.94% | 93.10% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.19% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.05% | 99.17% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 88.02% | 100.00% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 87.60% | 91.23% |
| CHEMBL4072 | P07858 | Cathepsin B | 86.97% | 93.67% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.14% | 90.20% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.46% | 90.71% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 83.41% | 97.23% |
| CHEMBL3308 | P55212 | Caspase-6 | 82.97% | 97.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.28% | 95.56% |
| CHEMBL1944 | P08473 | Neprilysin | 81.96% | 92.63% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.89% | 93.56% |
| CHEMBL3891 | P07384 | Calpain 1 | 81.41% | 93.04% |
| CHEMBL3663 | P62993 | Growth factor receptor-bound protein 2 | 80.98% | 90.00% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 80.20% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 125070 |
| LOTUS | LTS0211023 |
| wikiData | Q82890057 |