3-[(1R,4aS,7S,7aR)-4,7-dimethyl-3-(3-methylbutanoyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl]-2-methoxy-5-methylchromen-4-one
Internal ID | ca633cda-6936-4fd0-b87b-7bb09b9cba78 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 3-[(1R,4aS,7S,7aR)-4,7-dimethyl-3-(3-methylbutanoyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl]-2-methoxy-5-methylchromen-4-one |
SMILES (Canonical) | CC1CCC2C1C(OC(=C2C)C(=O)CC(C)C)C3=C(OC4=CC=CC(=C4C3=O)C)OC |
SMILES (Isomeric) | C[C@H]1CC[C@H]2[C@@H]1[C@@H](OC(=C2C)C(=O)CC(C)C)C3=C(OC4=CC=CC(=C4C3=O)C)OC |
InChI | InChI=1S/C26H32O5/c1-13(2)12-18(27)24-16(5)17-11-10-15(4)20(17)25(31-24)22-23(28)21-14(3)8-7-9-19(21)30-26(22)29-6/h7-9,13,15,17,20,25H,10-12H2,1-6H3/t15-,17+,20+,25+/m0/s1 |
InChI Key | WBPWUISPBMHPLX-BWIYXDQASA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H32O5 |
Molecular Weight | 424.50 g/mol |
Exact Mass | 424.22497412 g/mol |
Topological Polar Surface Area (TPSA) | 61.80 Ų |
XlogP | 5.30 |
There are no found synonyms. |
![2D Structure of 3-[(1R,4aS,7S,7aR)-4,7-dimethyl-3-(3-methylbutanoyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl]-2-methoxy-5-methylchromen-4-one 2D Structure of 3-[(1R,4aS,7S,7aR)-4,7-dimethyl-3-(3-methylbutanoyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl]-2-methoxy-5-methylchromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/d7b7b780-84f6-11ee-b29d-b76e3ba1c1b5.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.05% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.17% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.89% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.49% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.01% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.72% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.54% | 97.25% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.06% | 94.80% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.70% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.77% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.64% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.85% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 82.80% | 98.75% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.57% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.46% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.38% | 92.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.16% | 96.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.59% | 91.19% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.05% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lycoseris triplinervia |
PubChem | 162879416 |
LOTUS | LTS0231109 |
wikiData | Q105300900 |