1-[(1S,3aR,7S,7aR)-4-methylidene-7-propan-2-yl-1,2,3,3a,5,6,7,7a-octahydroinden-1-yl]-2-hydroxyethanone
| Internal ID | 9f39cf42-c720-4dfd-9262-89b1884ea6be |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 1-[(1S,3aR,7S,7aR)-4-methylidene-7-propan-2-yl-1,2,3,3a,5,6,7,7a-octahydroinden-1-yl]-2-hydroxyethanone |
| SMILES (Canonical) | CC(C)C1CCC(=C)C2C1C(CC2)C(=O)CO |
| SMILES (Isomeric) | CC(C)[C@@H]1CCC(=C)[C@H]2[C@@H]1[C@H](CC2)C(=O)CO |
| InChI | InChI=1S/C15H24O2/c1-9(2)11-5-4-10(3)12-6-7-13(15(11)12)14(17)8-16/h9,11-13,15-16H,3-8H2,1-2H3/t11-,12-,13+,15+/m0/s1 |
| InChI Key | ZKICAUCMQVTPQE-RMRHIDDWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.177630004 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of 1-[(1S,3aR,7S,7aR)-4-methylidene-7-propan-2-yl-1,2,3,3a,5,6,7,7a-octahydroinden-1-yl]-2-hydroxyethanone](https://plantaedb.com/storage/docs/compounds/2023/11/d7aa88a0-87d9-11ee-82e3-890601e4410c.jpg "2D Structure of 1-[(1S,3aR,7S,7aR)-4-methylidene-7-propan-2-yl-1,2,3,3a,5,6,7,7a-octahydroinden-1-yl]-2-hydroxyethanone")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.41% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.17% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.26% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.82% | 98.95% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 86.06% | 95.71% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 85.42% | 95.93% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.24% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.28% | 91.19% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.41% | 91.11% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.55% | 96.47% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.97% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.24% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pulicaria canariensis |
| PubChem | 162941167 |
| LOTUS | LTS0120289 |
| wikiData | Q105378477 |