[1,3,4,8-tetrahydroxy-6-methoxy-3-methyl-9,10-dioxo-5-(4,5,6,7,8-pentahydroxy-2-methoxy-7-methyl-9,10-dioxo-6,8-dihydro-5H-anthracen-1-yl)-2,4-dihydro-1H-anthracen-2-yl] acetate
| Internal ID | 01c37795-d469-4663-bb29-7b3b2ac46245 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
| IUPAC Name | [1,3,4,8-tetrahydroxy-6-methoxy-3-methyl-9,10-dioxo-5-(4,5,6,7,8-pentahydroxy-2-methoxy-7-methyl-9,10-dioxo-6,8-dihydro-5H-anthracen-1-yl)-2,4-dihydro-1H-anthracen-2-yl] acetate |
| SMILES (Canonical) | CC(=O)OC1C(C2=C(C(C1(C)O)O)C(=O)C3=C(C2=O)C(=CC(=C3C4=C(C=C(C5=C4C(=O)C6=C(C5=O)C(C(C(C6O)(C)O)O)O)O)OC)OC)O)O |
| SMILES (Isomeric) | CC(=O)OC1C(C2=C(C(C1(C)O)O)C(=O)C3=C(C2=O)C(=CC(=C3C4=C(C=C(C5=C4C(=O)C6=C(C5=O)C(C(C(C6O)(C)O)O)O)O)OC)OC)O)O |
| InChI | InChI=1S/C34H32O17/c1-8(35)51-32-28(43)20-22(30(45)34(32,3)48)26(41)18-14(24(20)39)10(37)7-12(50-5)16(18)15-11(49-4)6-9(36)13-17(15)25(40)21-19(23(13)38)27(42)31(46)33(2,47)29(21)44/h6-7,27-32,36-37,42-48H,1-5H3 |
| InChI Key | XXIDNLWSJPIFHF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C34H32O17 |
| Molecular Weight | 712.60 g/mol |
| Exact Mass | 712.16394955 g/mol |
| Topological Polar Surface Area (TPSA) | 295.00 Ų |
| XlogP | -2.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.18% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.25% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.79% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.46% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.79% | 91.19% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.07% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.96% | 90.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.23% | 92.94% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.83% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.48% | 89.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.06% | 97.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.42% | 98.75% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.11% | 91.07% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.07% | 94.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.75% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139587174 |
| LOTUS | LTS0221035 |
| wikiData | Q77559572 |