7-[2-(furan-3-yl)propyl]-8-methyl-3-oxo-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7-carboxylic acid
| Internal ID | 9aeae477-f877-41e9-a905-35c2f8cc4835 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | 7-[2-(furan-3-yl)propyl]-8-methyl-3-oxo-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7-carboxylic acid |
| SMILES (Canonical) | CC1CCC23COC(=O)C2=CCCC3C1(CC(C)C4=COC=C4)C(=O)O |
| SMILES (Isomeric) | CC1CCC23COC(=O)C2=CCCC3C1(CC(C)C4=COC=C4)C(=O)O |
| InChI | InChI=1S/C21H26O5/c1-13(15-7-9-25-11-15)10-21(19(23)24)14(2)6-8-20-12-26-18(22)16(20)4-3-5-17(20)21/h4,7,9,11,13-14,17H,3,5-6,8,10,12H2,1-2H3,(H,23,24) |
| InChI Key | QJSXPJCSCZFGGZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.17802393 g/mol |
| Topological Polar Surface Area (TPSA) | 76.70 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
![2D Structure of 7-[2-(furan-3-yl)propyl]-8-methyl-3-oxo-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/d71151f0-86df-11ee-85d1-cd0e4638eacf.jpg "2D Structure of 7-[2-(furan-3-yl)propyl]-8-methyl-3-oxo-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7-carboxylic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.90% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.55% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.95% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.68% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.99% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.30% | 97.25% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.64% | 99.23% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.49% | 90.17% |
| CHEMBL5028 | O14672 | ADAM10 | 87.39% | 97.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.24% | 97.09% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.65% | 93.04% |
| CHEMBL4072 | P07858 | Cathepsin B | 83.93% | 93.67% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.72% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.76% | 90.71% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.33% | 95.71% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.59% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Baccharis subdentata |
| PubChem | 162899549 |
| LOTUS | LTS0079330 |
| wikiData | Q105222861 |