[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-methoxy-5,7-dimethylnaphthalen-2-yl)oxyoxan-2-yl]methyl (4aS,4bS,7S,8aS,10aS)-7-ethyl-1,1,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-4a-carboxylate
Internal ID | 9d0ecbce-02b0-4835-8dd9-a8247171fd42 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-methoxy-5,7-dimethylnaphthalen-2-yl)oxyoxan-2-yl]methyl (4aS,4bS,7S,8aS,10aS)-7-ethyl-1,1,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-4a-carboxylate |
SMILES (Canonical) | CCC1(CCC2C(C1)CCC3C2(CCCC3(C)C)C(=O)OCC4C(C(C(C(O4)OC5=CC6=CC(=CC(=C6C=C5OC)C)C)O)O)O)C |
SMILES (Isomeric) | CC[C@]1(CC[C@H]2[C@H](C1)CC[C@@H]3[C@@]2(CCCC3(C)C)C(=O)OC[C@@H]4[C@H]([C@@H]([C@H]([C@@H](O4)OC5=CC6=CC(=CC(=C6C=C5OC)C)C)O)O)O)C |
InChI | InChI=1S/C39H56O8/c1-8-38(6)15-12-27-24(20-38)10-11-31-37(4,5)13-9-14-39(27,31)36(43)45-21-30-32(40)33(41)34(42)35(47-30)46-29-18-25-17-22(2)16-23(3)26(25)19-28(29)44-7/h16-19,24,27,30-35,40-42H,8-15,20-21H2,1-7H3/t24-,27-,30+,31-,32+,33-,34+,35+,38-,39-/m0/s1 |
InChI Key | NXJZBMCVJSZPES-PHIUHCAQSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C39H56O8 |
Molecular Weight | 652.90 g/mol |
Exact Mass | 652.39751874 g/mol |
Topological Polar Surface Area (TPSA) | 115.00 Ų |
XlogP | 8.70 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-methoxy-5,7-dimethylnaphthalen-2-yl)oxyoxan-2-yl]methyl (4aS,4bS,7S,8aS,10aS)-7-ethyl-1,1,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-4a-carboxylate 2D Structure of [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-methoxy-5,7-dimethylnaphthalen-2-yl)oxyoxan-2-yl]methyl (4aS,4bS,7S,8aS,10aS)-7-ethyl-1,1,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-4a-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/d6ca82e0-8454-11ee-b157-9b5fa0d06797.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.45% | 91.11% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 97.45% | 92.94% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.44% | 96.09% |
CHEMBL220 | P22303 | Acetylcholinesterase | 96.26% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.94% | 96.61% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.76% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.99% | 97.25% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.55% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.53% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.09% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.96% | 92.62% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.89% | 96.38% |
CHEMBL2581 | P07339 | Cathepsin D | 89.88% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.65% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.62% | 95.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.59% | 92.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.03% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.10% | 89.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.10% | 89.62% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.35% | 94.75% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.91% | 96.21% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.54% | 93.04% |
CHEMBL5028 | O14672 | ADAM10 | 84.34% | 97.50% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.73% | 96.43% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.55% | 95.83% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.20% | 92.98% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.74% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.56% | 96.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.09% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Catharanthus roseus |
PubChem | 163025450 |
LOTUS | LTS0051708 |
wikiData | Q105187223 |