[(3S,4R,4aR,5S,7R,8S,8aR)-8-[(2S)-2-acetyloxy-2-(furan-3-yl)ethyl]-3,5-dihydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl acetate
Internal ID | 4d4c49a5-f4ff-4f56-9974-88ea6aa2c7de |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Dicarboxylic acids and derivatives |
IUPAC Name | [(3S,4R,4aR,5S,7R,8S,8aR)-8-[(2S)-2-acetyloxy-2-(furan-3-yl)ethyl]-3,5-dihydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl acetate |
SMILES (Canonical) | CC1CC(C2(C(C1(C)CC(C3=COC=C3)OC(=O)C)CCC(C24CO4)O)COC(=O)C)O |
SMILES (Isomeric) | C[C@@H]1C[C@@H]([C@@]2([C@@H]([C@@]1(C)C[C@@H](C3=COC=C3)OC(=O)C)CC[C@@H]([C@]24CO4)O)COC(=O)C)O |
InChI | InChI=1S/C24H34O8/c1-14-9-21(28)23(12-30-15(2)25)19(5-6-20(27)24(23)13-31-24)22(14,4)10-18(32-16(3)26)17-7-8-29-11-17/h7-8,11,14,18-21,27-28H,5-6,9-10,12-13H2,1-4H3/t14-,18+,19-,20+,21+,22+,23+,24-/m1/s1 |
InChI Key | DXKNBOULLLBFAY-WDBPYMAQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H34O8 |
Molecular Weight | 450.50 g/mol |
Exact Mass | 450.22536804 g/mol |
Topological Polar Surface Area (TPSA) | 119.00 Ų |
XlogP | 1.70 |
There are no found synonyms. |
![2D Structure of [(3S,4R,4aR,5S,7R,8S,8aR)-8-[(2S)-2-acetyloxy-2-(furan-3-yl)ethyl]-3,5-dihydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl acetate 2D Structure of [(3S,4R,4aR,5S,7R,8S,8aR)-8-[(2S)-2-acetyloxy-2-(furan-3-yl)ethyl]-3,5-dihydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/d6c4b010-873e-11ee-ac65-87c615d86754.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.74% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.45% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.58% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.26% | 98.95% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 94.44% | 94.80% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.87% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.24% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.59% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.48% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.00% | 96.00% |
CHEMBL5028 | O14672 | ADAM10 | 83.94% | 97.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.56% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.27% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.95% | 99.17% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.38% | 95.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.66% | 95.56% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 80.06% | 92.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.00% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Teucrium gracile |
PubChem | 23254270 |
LOTUS | LTS0247418 |
wikiData | Q104991050 |