5-[2-(7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl)ethenyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol
Internal ID | 9bc64d66-c2d7-488c-805c-f7000fe69ccf |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthenes |
IUPAC Name | 5-[2-(7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl)ethenyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol |
SMILES (Canonical) | CC(=CCC1=C(C=C(C=C1O)C=CC2=CC3=C(C(=C2)OC)OC4(CCC(C(C4C3)(C)C)O)C)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C=C(C=C1O)C=CC2=CC3=C(C(=C2)OC)OC4(CCC(C(C4C3)(C)C)O)C)O)C |
InChI | InChI=1S/C30H38O5/c1-18(2)7-10-22-23(31)14-20(15-24(22)32)9-8-19-13-21-17-26-29(3,4)27(33)11-12-30(26,5)35-28(21)25(16-19)34-6/h7-9,13-16,26-27,31-33H,10-12,17H2,1-6H3 |
InChI Key | BUFNPAYKUGAAAO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H38O5 |
Molecular Weight | 478.60 g/mol |
Exact Mass | 478.27192431 g/mol |
Topological Polar Surface Area (TPSA) | 79.20 Ų |
XlogP | 7.00 |
There are no found synonyms. |
![2D Structure of 5-[2-(7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl)ethenyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol 2D Structure of 5-[2-(7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl)ethenyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol](https://plantaedb.com/storage/docs/compounds/2023/11/d67b3bc0-8272-11ee-8827-95b59f33d41e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.81% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.86% | 92.94% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.71% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.03% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.68% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.47% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.12% | 96.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.28% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.91% | 96.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.82% | 91.49% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.57% | 91.03% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.56% | 93.99% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.54% | 92.62% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 84.42% | 92.68% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.04% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.88% | 90.17% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.09% | 95.50% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.45% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.40% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.35% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.97% | 98.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.79% | 89.62% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.69% | 97.21% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.31% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.03% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Macaranga alnifolia |
PubChem | 73310364 |
LOTUS | LTS0129069 |
wikiData | Q104946067 |