[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1R,3aS,5aR,5bR,7aR,9R,11aR,11bR,13aR,13bS)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate
Internal ID | e372067e-073f-4370-bef1-5d1b3067e4b2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1R,3aS,5aR,5bR,7aR,9R,11aR,11bR,13aR,13bS)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC(=O)C45CCC(C4C6CCC7C8(CCC(C(C8CCC7(C6(CC5)C)C)(C)C)O)C)C(=C)C)O)O)O)CO)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@@H]2O)O)OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)OC(=O)[C@]45CC[C@H]([C@H]4[C@H]6CC[C@@H]7[C@]8(CC[C@H](C([C@@H]8CC[C@]7([C@@]6(CC5)C)C)(C)C)O)C)C(=C)C)O)O)O)CO)O)O)O |
InChI | InChI=1S/C48H78O17/c1-21(2)23-11-16-48(18-17-46(7)24(30(23)48)9-10-28-45(6)14-13-29(50)44(4,5)27(45)12-15-47(28,46)8)43(59)65-42-37(57)34(54)32(52)26(63-42)20-60-40-38(58)35(55)39(25(19-49)62-40)64-41-36(56)33(53)31(51)22(3)61-41/h22-42,49-58H,1,9-20H2,2-8H3/t22-,23-,24+,25+,26+,27-,28+,29+,30-,31-,32+,33+,34-,35-,36+,37+,38+,39+,40+,41-,42-,45-,46+,47+,48-/m0/s1 |
InChI Key | KRJGIYUSEZHRFC-KGDMGZDYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H78O17 |
Molecular Weight | 927.10 g/mol |
Exact Mass | 926.52390102 g/mol |
Topological Polar Surface Area (TPSA) | 275.00 Ų |
XlogP | 2.60 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1R,3aS,5aR,5bR,7aR,9R,11aR,11bR,13aR,13bS)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate 2D Structure of [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1R,3aS,5aR,5bR,7aR,9R,11aR,11bR,13aR,13bS)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/d6017670-865d-11ee-99c9-890604831d13.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.39% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.30% | 91.11% |
CHEMBL233 | P35372 | Mu opioid receptor | 95.57% | 97.93% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.70% | 96.61% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.10% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 92.09% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.61% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.59% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.87% | 86.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.60% | 95.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.17% | 97.36% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.10% | 96.77% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.11% | 92.50% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.91% | 91.24% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.86% | 95.89% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.66% | 92.86% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.21% | 96.38% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.00% | 92.94% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.88% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.88% | 100.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.99% | 89.05% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.87% | 89.00% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 84.82% | 96.09% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.39% | 97.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.20% | 91.19% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 84.02% | 97.86% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.63% | 94.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.43% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.42% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.36% | 95.83% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.21% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.59% | 98.10% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.62% | 100.00% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.46% | 92.32% |
CHEMBL5028 | O14672 | ADAM10 | 80.40% | 97.50% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.13% | 82.50% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.08% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eleutherococcus nodiflorus |
PubChem | 162974217 |
LOTUS | LTS0143982 |
wikiData | Q105145040 |