[(1S,14R,16R,20R,21S,22S)-21,22-dihydroxy-5,8-dimethoxy-24-azapentacyclo[14.7.1.12,6.17,11.020,24]hexacosa-2(26),3,5,7,9,11(25)-hexaen-14-yl] acetate
| Internal ID | a9cf9447-091e-4e3e-891e-533be8a37704 |
| Taxonomy | Organoheterocyclic compounds > Quinolizidines |
| IUPAC Name | [(1S,14R,16R,20R,21S,22S)-21,22-dihydroxy-5,8-dimethoxy-24-azapentacyclo[14.7.1.12,6.17,11.020,24]hexacosa-2(26),3,5,7,9,11(25)-hexaen-14-yl] acetate |
| SMILES (Canonical) | CC(=O)OC1CCC2=CC(=C(C=C2)OC)C3=C(C=CC(=C3)C4CC(C(C5N4C(C1)CCC5)O)O)OC |
| SMILES (Isomeric) | CC(=O)O[C@@H]1CCC2=CC(=C(C=C2)OC)C3=C(C=CC(=C3)[C@@H]4C[C@@H]([C@H]([C@@H]5N4[C@@H](C1)CCC5)O)O)OC |
| InChI | InChI=1S/C29H37NO6/c1-17(31)36-21-10-7-18-8-11-27(34-2)22(13-18)23-14-19(9-12-28(23)35-3)25-16-26(32)29(33)24-6-4-5-20(15-21)30(24)25/h8-9,11-14,20-21,24-26,29,32-33H,4-7,10,15-16H2,1-3H3/t20-,21-,24-,25+,26+,29+/m1/s1 |
| InChI Key | PHZITYJHCYPBFZ-OCQHLOMZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H37NO6 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.26208790 g/mol |
| Topological Polar Surface Area (TPSA) | 88.50 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.05% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.52% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.95% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.62% | 95.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.60% | 91.19% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.13% | 83.82% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.11% | 97.09% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 90.44% | 97.31% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.60% | 91.49% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.89% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.49% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.61% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.40% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.61% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.29% | 89.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.28% | 96.77% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.71% | 89.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.64% | 86.33% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.59% | 88.48% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.16% | 82.69% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.12% | 89.50% |
| CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 82.54% | 94.05% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.95% | 95.89% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.51% | 97.21% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.45% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163010346 |
| LOTUS | LTS0079222 |
| wikiData | Q105209341 |