[5-hydroxy-2,8-bis(4-hydroxyphenyl)-3,4-dihydro-2H-furo[2,3-h]chromen-9-yl]-(2,4,6-trihydroxyphenyl)methanone
Internal ID | 01b0d02e-b3e2-4de6-84bf-85152d66ff01 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | [5-hydroxy-2,8-bis(4-hydroxyphenyl)-3,4-dihydro-2H-furo[2,3-h]chromen-9-yl]-(2,4,6-trihydroxyphenyl)methanone |
SMILES (Canonical) | C1CC2=C(C3=C(C=C2O)OC(=C3C(=O)C4=C(C=C(C=C4O)O)O)C5=CC=C(C=C5)O)OC1C6=CC=C(C=C6)O |
SMILES (Isomeric) | C1CC2=C(C3=C(C=C2O)OC(=C3C(=O)C4=C(C=C(C=C4O)O)O)C5=CC=C(C=C5)O)OC1C6=CC=C(C=C6)O |
InChI | InChI=1S/C30H22O9/c31-16-5-1-14(2-6-16)23-10-9-19-20(34)13-24-26(30(19)38-23)27(29(39-24)15-3-7-17(32)8-4-15)28(37)25-21(35)11-18(33)12-22(25)36/h1-8,11-13,23,31-36H,9-10H2 |
InChI Key | SFIBBWQCUADULX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H22O9 |
Molecular Weight | 526.50 g/mol |
Exact Mass | 526.12638228 g/mol |
Topological Polar Surface Area (TPSA) | 161.00 Ų |
XlogP | 5.60 |
InChI=1/C30H22O9/c31-16-5-1-14(2-6-16)23-10-9-19-20(34)13-24-26(30(19)38-23)27(29(39-24)15-3-7-17(32)8-4-15)28(37)25-21(35)11-18(33)12-22(25)36/h1-8,11-13,23,31-36H,9-10H |
![2D Structure of [5-hydroxy-2,8-bis(4-hydroxyphenyl)-3,4-dihydro-2H-furo[2,3-h]chromen-9-yl]-(2,4,6-trihydroxyphenyl)methanone 2D Structure of [5-hydroxy-2,8-bis(4-hydroxyphenyl)-3,4-dihydro-2H-furo[2,3-h]chromen-9-yl]-(2,4,6-trihydroxyphenyl)methanone](https://plantaedb.com/storage/docs/compounds/2023/11/d5e2ea50-86aa-11ee-9b4d-a5174699dea8.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.52% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.24% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.57% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 92.47% | 90.71% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 92.27% | 95.78% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 90.07% | 98.35% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 89.68% | 95.62% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.15% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.95% | 94.45% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 87.95% | 96.12% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.08% | 95.64% |
CHEMBL2581 | P07339 | Cathepsin D | 84.76% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.73% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.72% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.68% | 91.19% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.58% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.73% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.74% | 99.15% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.20% | 92.94% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.04% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Daphne feddei |
Daphne odora |
PubChem | 13915094 |
LOTUS | LTS0136304 |
wikiData | Q105251756 |