8-Benzyl-14,23-di(butan-2-yl)-11-(2-methylbut-3-en-2-yloxymethyl)-28-thia-6,9,12,15,21,24,29-heptazatetracyclo[24.2.1.02,6.017,21]nonacos-1(29)-ene-7,10,13,16,22,25-hexone
| Internal ID | bf9a7eb3-0fc8-45f7-a6fb-5141a92826e5 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 8-benzyl-14,23-di(butan-2-yl)-11-(2-methylbut-3-en-2-yloxymethyl)-28-thia-6,9,12,15,21,24,29-heptazatetracyclo[24.2.1.02,6.017,21]nonacos-1(29)-ene-7,10,13,16,22,25-hexone |
| SMILES (Canonical) | CCC(C)C1C(=O)NC(C(=O)NC(C(=O)N2CCCC2C3=NC(CS3)C(=O)NC(C(=O)N4CCCC4C(=O)N1)C(C)CC)CC5=CC=CC=C5)COC(C)(C)C=C |
| SMILES (Isomeric) | CCC(C)C1C(=O)NC(C(=O)NC(C(=O)N2CCCC2C3=NC(CS3)C(=O)NC(C(=O)N4CCCC4C(=O)N1)C(C)CC)CC5=CC=CC=C5)COC(C)(C)C=C |
| InChI | InChI=1S/C42H61N7O7S/c1-8-25(4)33-38(53)44-29(23-56-42(6,7)10-3)35(50)43-28(22-27-16-12-11-13-17-27)40(54)49-21-15-19-32(49)39-45-30(24-57-39)36(51)47-34(26(5)9-2)41(55)48-20-14-18-31(48)37(52)46-33/h10-13,16-17,25-26,28-34H,3,8-9,14-15,18-24H2,1-2,4-7H3,(H,43,50)(H,44,53)(H,46,52)(H,47,51) |
| InChI Key | WOJHPNQVQSSJML-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H61N7O7S |
| Molecular Weight | 808.00 g/mol |
| Exact Mass | 807.43531848 g/mol |
| Topological Polar Surface Area (TPSA) | 204.00 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.66% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.06% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.36% | 96.09% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 96.20% | 97.64% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 95.97% | 92.97% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.06% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.68% | 95.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.07% | 90.08% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 93.57% | 82.38% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.51% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.49% | 86.33% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 93.04% | 97.05% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.49% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.69% | 97.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.61% | 94.62% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.84% | 93.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.17% | 97.25% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 88.10% | 99.18% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 86.71% | 94.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.13% | 97.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.34% | 91.11% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 83.33% | 91.43% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 82.04% | 90.65% |
| CHEMBL4447 | Q9Y337 | Kallikrein 5 | 81.68% | 87.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.54% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162872141 |
| LOTUS | LTS0081971 |
| wikiData | Q105309537 |