(3aS)-8-[[(1S,19R,21S,22R,23R)-6,7,8,11,12,13,23-heptahydroxy-3,16-dioxo-21-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-22-yl]oxycarbonyl]-3a,5,6-trihydroxy-3-oxo-2H-cyclopenta[b][1]benzofuran-1-carboxylic acid
Internal ID | 41c3da84-6877-4116-9913-9fa4dcd0d28d |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | (3aS)-8-[[(1S,19R,21S,22R,23R)-6,7,8,11,12,13,23-heptahydroxy-3,16-dioxo-21-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-22-yl]oxycarbonyl]-3a,5,6-trihydroxy-3-oxo-2H-cyclopenta[b][1]benzofuran-1-carboxylic acid |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C5=C4C6=C(CC(=O)C6(O5)O)C(=O)O)O)O)OC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O1)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C5=C4C6=C(CC(=O)[C@]6(O5)O)C(=O)O)O)O)OC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O1)O)O)O)O)O)O)O |
InChI | InChI=1S/C40H28O26/c41-13-1-8(2-14(42)24(13)47)35(56)65-39-33(64-38(59)11-5-17(45)27(50)31-22(11)23-12(34(54)55)6-19(46)40(23,60)66-31)32-28(51)18(62-39)7-61-36(57)9-3-15(43)25(48)29(52)20(9)21-10(37(58)63-32)4-16(44)26(49)30(21)53/h1-5,18,28,32-33,39,41-45,47-53,60H,6-7H2,(H,54,55)/t18-,28-,32+,33-,39+,40-/m1/s1 |
InChI Key | BDUNEEXSCSRFCR-GIRGNLGXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H28O26 |
Molecular Weight | 924.60 g/mol |
Exact Mass | 924.08688099 g/mol |
Topological Polar Surface Area (TPSA) | 441.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
![2D Structure of (3aS)-8-[[(1S,19R,21S,22R,23R)-6,7,8,11,12,13,23-heptahydroxy-3,16-dioxo-21-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-22-yl]oxycarbonyl]-3a,5,6-trihydroxy-3-oxo-2H-cyclopenta[b][1]benzofuran-1-carboxylic acid 2D Structure of (3aS)-8-[[(1S,19R,21S,22R,23R)-6,7,8,11,12,13,23-heptahydroxy-3,16-dioxo-21-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-22-yl]oxycarbonyl]-3a,5,6-trihydroxy-3-oxo-2H-cyclopenta[b][1]benzofuran-1-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/d5a8d500-875a-11ee-a6ef-a5a7835cd4c2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.09% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.68% | 85.14% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 94.55% | 83.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.78% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 92.15% | 98.95% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 91.86% | 89.63% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 90.88% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.29% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.87% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.56% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.78% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.56% | 86.33% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 87.71% | 94.42% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.54% | 95.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.91% | 92.50% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.61% | 96.38% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.46% | 91.19% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.63% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.89% | 92.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.86% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.09% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.90% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.34% | 95.89% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.21% | 93.18% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.01% | 96.21% |
CHEMBL3194 | P02766 | Transthyretin | 80.16% | 90.71% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.00% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pelargonium reniforme |
PubChem | 162917829 |
LOTUS | LTS0094262 |
wikiData | Q104924734 |