[(2S,3R,4R,5R,6S)-4-hydroxy-6-methyl-2-[[(1S,3R,4S,5S,6R,8R,10R,22S,23R,24R,26R)-4,5,23-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-26-yl]oxy]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] (2S)-2-methylbutanoate
| Internal ID | faa2b5fa-4a13-4625-a18e-6719b5615b09 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | [(2S,3R,4R,5R,6S)-4-hydroxy-6-methyl-2-[[(1S,3R,4S,5S,6R,8R,10R,22S,23R,24R,26R)-4,5,23-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-26-yl]oxy]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] (2S)-2-methylbutanoate |
| SMILES (Canonical) | CCCCCC1CCCCCCCCCC(=O)OC2C(C(OC(C2OC3C(C(C(C(O3)C)OC4C(C(C(C(O4)C)O)O)O)O)OC(=O)C(C)CC)OC5C(C(C(OC5O1)C)O)O)C)O |
| SMILES (Isomeric) | CCCCC[C@@H]1CCCCCCCCCC(=O)O[C@H]2[C@@H]([C@H](O[C@H]([C@@H]2O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C)O)O)O)O)OC(=O)[C@@H](C)CC)O[C@@H]5[C@H]([C@@H]([C@H](O[C@H]5O1)C)O)O)C)O |
| InChI | InChI=1S/C45H78O19/c1-8-10-16-19-27-20-17-14-12-11-13-15-18-21-28(46)60-37-31(49)25(6)57-45(63-38-33(51)30(48)24(5)56-43(38)59-27)40(37)64-44-39(61-41(54)22(3)9-2)35(53)36(26(7)58-44)62-42-34(52)32(50)29(47)23(4)55-42/h22-27,29-40,42-45,47-53H,8-21H2,1-7H3/t22-,23+,24+,25+,26-,27+,29+,30+,31+,32-,33-,34+,35+,36-,37-,38+,39+,40+,42-,43-,44-,45-/m0/s1 |
| InChI Key | MPJBNNHNNFFCIG-HBWSSFHBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C45H78O19 |
| Molecular Weight | 923.10 g/mol |
| Exact Mass | 922.51373025 g/mol |
| Topological Polar Surface Area (TPSA) | 268.00 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
![2D Structure of [(2S,3R,4R,5R,6S)-4-hydroxy-6-methyl-2-[[(1S,3R,4S,5S,6R,8R,10R,22S,23R,24R,26R)-4,5,23-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-26-yl]oxy]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] (2S)-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/d58aeba0-864e-11ee-908d-17a71933ad48.jpg "2D Structure of [(2S,3R,4R,5R,6S)-4-hydroxy-6-methyl-2-[[(1S,3R,4S,5S,6R,8R,10R,22S,23R,24R,26R)-4,5,23-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-26-yl]oxy]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] (2S)-2-methylbutanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.06% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.44% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.34% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.26% | 97.25% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 93.58% | 90.24% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.85% | 93.56% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.68% | 100.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.41% | 96.38% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.29% | 92.62% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.79% | 96.47% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.21% | 92.50% |
| CHEMBL4072 | P07858 | Cathepsin B | 89.53% | 93.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.74% | 99.17% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.89% | 94.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.84% | 90.71% |
| CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 87.70% | 98.57% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.11% | 91.19% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.57% | 89.00% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.69% | 83.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.31% | 95.50% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.23% | 97.79% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.01% | 94.73% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.79% | 95.89% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.49% | 96.61% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.11% | 95.64% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.04% | 96.77% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.97% | 97.09% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.86% | 98.75% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.06% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.98% | 95.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.66% | 100.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.33% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ipomoea capillacea |
| PubChem | 21769857 |
| LOTUS | LTS0130742 |
| wikiData | Q105169558 |