15-Methyl-7,9,19,21-tetraoxa-15-azapentacyclo[15.7.0.04,12.06,10.018,22]tetracosa-1(17),4,6(10),11,18(22),23-hexaene
| Internal ID | 46b7b5e3-c28e-430e-ab85-53799a732ae7 |
| Taxonomy | Organoheterocyclic compounds > Dibenzazecins |
| IUPAC Name | 15-methyl-7,9,19,21-tetraoxa-15-azapentacyclo[15.7.0.04,12.06,10.018,22]tetracosa-1(17),4,6(10),11,18(22),23-hexaene |
| SMILES (Canonical) | CN1CCC2=CC3=C(C=C2CCC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
| SMILES (Isomeric) | CN1CCC2=CC3=C(C=C2CCC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
| InChI | InChI=1S/C20H21NO4/c1-21-7-6-15-9-19-18(23-11-24-19)8-14(15)3-2-13-4-5-17-20(16(13)10-21)25-12-22-17/h4-5,8-9H,2-3,6-7,10-12H2,1H3 |
| InChI Key | KNGKJOJXPBGGOV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 40.20 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
![2D Structure of 15-Methyl-7,9,19,21-tetraoxa-15-azapentacyclo[15.7.0.04,12.06,10.018,22]tetracosa-1(17),4,6(10),11,18(22),23-hexaene](https://plantaedb.com/storage/docs/compounds/2023/11/d535ebf0-85cb-11ee-9a9c-2321431593a3.jpg "2D Structure of 15-Methyl-7,9,19,21-tetraoxa-15-azapentacyclo[15.7.0.04,12.06,10.018,22]tetracosa-1(17),4,6(10),11,18(22),23-hexaene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 98.18% | 93.40% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.22% | 96.77% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.35% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.22% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.84% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.10% | 98.95% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 90.10% | 81.29% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 89.45% | 93.65% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.78% | 90.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.12% | 94.80% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 87.69% | 91.00% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 86.90% | 90.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.50% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.21% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.91% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.81% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.66% | 95.89% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.40% | 82.67% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 81.80% | 83.14% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.60% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Corydalis orthopoda |
| Glaucium fimbrilligerum |
| PubChem | 15765609 |
| LOTUS | LTS0217682 |
| wikiData | Q105143408 |