6-[1-[(11E)-51-[4-[[3-[(3-amino-3-oxoprop-1-en-2-yl)amino]-3-oxoprop-1-en-2-yl]carbamoyl]-1,3-thiazol-2-yl]-18-(2,3-dihydroxybutan-2-yl)-11-ethylidene-59-hydroxy-8-(1-hydroxyethyl)-26,46-dimethyl-40,43-dimethylidene-6,9,16,23,28,38,41,44,47-nonaoxo-37-propan-2-yl-27-oxa-3,13,20,56-tetrathia-7,10,17,24,36,39,42,45,48,52,58,61,62,63,64-pentadecazanonacyclo[23.23.9.329,35.12,5.112,15.119,22.154,57.01,53.032,60]tetrahexaconta-2(64),4,12(63),19(62),21,29(61),30,32(60),33,51,54,57-dodecaen-31-yl]ethoxy]-6-oxohexanoic acid
| Internal ID | eeab67b9-930f-4e8e-b585-5e57d43755aa |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 6-[1-[(11E)-51-[4-[[3-[(3-amino-3-oxoprop-1-en-2-yl)amino]-3-oxoprop-1-en-2-yl]carbamoyl]-1,3-thiazol-2-yl]-18-(2,3-dihydroxybutan-2-yl)-11-ethylidene-59-hydroxy-8-(1-hydroxyethyl)-26,46-dimethyl-40,43-dimethylidene-6,9,16,23,28,38,41,44,47-nonaoxo-37-propan-2-yl-27-oxa-3,13,20,56-tetrathia-7,10,17,24,36,39,42,45,48,52,58,61,62,63,64-pentadecazanonacyclo[23.23.9.329,35.12,5.112,15.119,22.154,57.01,53.032,60]tetrahexaconta-2(64),4,12(63),19(62),21,29(61),30,32(60),33,51,54,57-dodecaen-31-yl]ethoxy]-6-oxohexanoic acid |
| SMILES (Canonical) | CC=C1C2=NC(CS2)C(=O)NC(C3=NC(=CS3)C(=O)NC4C(OC(=O)C5=NC6=C(C=CC(C6O)NC(C(=O)NC(=C)C(=O)NC(=C)C(=O)NC(C(=O)NC7(CCC(=NC7C8=CSC4=N8)C9=NC(=CS9)C(=O)NC(=C)C(=O)NC(=C)C(=O)N)C2=NC(=CS2)C(=O)NC(C(=O)N1)C(C)O)C)C(C)C)C(=C5)C(C)OC(=O)CCCCC(=O)O)C)C(C)(C(C)O)O |
| SMILES (Isomeric) | C/C=C/1\C2=NC(CS2)C(=O)NC(C3=NC(=CS3)C(=O)NC4C(OC(=O)C5=NC6=C(C=CC(C6O)NC(C(=O)NC(=C)C(=O)NC(=C)C(=O)NC(C(=O)NC7(CCC(=NC7C8=CSC4=N8)C9=NC(=CS9)C(=O)NC(=C)C(=O)NC(=C)C(=O)N)C2=NC(=CS2)C(=O)NC(C(=O)N1)C(C)O)C)C(C)C)C(=C5)C(C)OC(=O)CCCCC(=O)O)C)C(C)(C(C)O)O |
| InChI | InChI=1S/C77H89N19O21S5/c1-14-41-70-89-48(26-118-70)67(111)95-58(76(13,115)38(12)98)73-91-47(27-121-73)65(109)94-54-37(11)117-74(114)44-23-40(36(10)116-51(101)18-16-15-17-50(99)100)39-19-20-42(56(102)55(39)85-44)84-52(29(2)3)68(112)83-33(7)62(106)80-31(5)61(105)81-34(8)63(107)96-77(75-92-49(28-122-75)66(110)93-53(35(9)97)69(113)87-41)22-21-43(86-57(77)45-24-120-72(54)88-45)71-90-46(25-119-71)64(108)82-32(6)60(104)79-30(4)59(78)103/h14,19-20,23-25,27-29,34-38,42,48,52-54,56-58,84,97-98,102,115H,4-7,15-18,21-22,26H2,1-3,8-13H3,(H2,78,103)(H,79,104)(H,80,106)(H,81,105)(H,82,108)(H,83,112)(H,87,113)(H,93,110)(H,94,109)(H,95,111)(H,96,107)(H,99,100)/b41-14+ |
| InChI Key | DZHPNBVNDWMWHY-GKNFWFERSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C77H89N19O21S5 |
| Molecular Weight | 1777.00 g/mol |
| Exact Mass | 1775.5083968 g/mol |
| Topological Polar Surface Area (TPSA) | 744.00 Ų |
| XlogP | -1.10 |
| Atomic LogP (AlogP) | 1.70 |
| H-Bond Acceptor | 33 |
| H-Bond Donor | 17 |
| Rotatable Bonds | 17 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5327 | 53.27% |
| Caco-2 | - | 0.8596 | 85.96% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.7857 | 78.57% |
| Subcellular localzation | Mitochondria | 0.5723 | 57.23% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.7983 | 79.83% |
| OATP1B3 inhibitior | + | 0.9292 | 92.92% |
| MATE1 inhibitior | - | 0.9246 | 92.46% |
| OCT2 inhibitior | - | 0.8561 | 85.61% |
| BSEP inhibitior | + | 0.9687 | 96.87% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8661 | 86.61% |
| CYP3A4 substrate | + | 0.7649 | 76.49% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8547 | 85.47% |
| CYP3A4 inhibition | - | 0.7213 | 72.13% |
| CYP2C9 inhibition | - | 0.8039 | 80.39% |
| CYP2C19 inhibition | - | 0.7390 | 73.90% |
| CYP2D6 inhibition | - | 0.9034 | 90.34% |
| CYP1A2 inhibition | - | 0.8029 | 80.29% |
| CYP2C8 inhibition | + | 0.8773 | 87.73% |
| CYP inhibitory promiscuity | - | 0.5431 | 54.31% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9600 | 96.00% |
| Carcinogenicity (trinary) | Non-required | 0.5248 | 52.48% |
| Eye corrosion | - | 0.9815 | 98.15% |
| Eye irritation | - | 0.8952 | 89.52% |
| Skin irritation | - | 0.7586 | 75.86% |
| Skin corrosion | - | 0.9158 | 91.58% |
| Ames mutagenesis | - | 0.5600 | 56.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7076 | 70.76% |
| Micronuclear | + | 0.7100 | 71.00% |
| Hepatotoxicity | - | 0.5715 | 57.15% |
| skin sensitisation | - | 0.8191 | 81.91% |
| Respiratory toxicity | + | 0.8667 | 86.67% |
| Reproductive toxicity | + | 0.9556 | 95.56% |
| Mitochondrial toxicity | + | 0.9125 | 91.25% |
| Nephrotoxicity | - | 0.8802 | 88.02% |
| Acute Oral Toxicity (c) | III | 0.5879 | 58.79% |
| Estrogen receptor binding | - | 0.6425 | 64.25% |
| Androgen receptor binding | + | 0.8262 | 82.62% |
| Thyroid receptor binding | + | 0.8263 | 82.63% |
| Glucocorticoid receptor binding | + | 0.8762 | 87.62% |
| Aromatase binding | + | 0.8252 | 82.52% |
| PPAR gamma | + | 0.8101 | 81.01% |
| Honey bee toxicity | - | 0.5946 | 59.46% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5600 | 56.00% |
| Fish aquatic toxicity | + | 0.9692 | 96.92% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.31% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.22% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.65% | 89.63% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 98.36% | 93.03% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.14% | 85.14% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 97.66% | 98.03% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.11% | 95.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.40% | 95.56% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 95.16% | 95.71% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.12% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.12% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.09% | 98.95% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 95.00% | 96.38% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 94.74% | 96.47% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.87% | 93.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 92.76% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.67% | 90.17% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 92.35% | 95.69% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.27% | 90.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.55% | 94.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.42% | 99.23% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 91.31% | 92.88% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.23% | 96.90% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.33% | 96.21% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.94% | 99.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.65% | 100.00% |
| CHEMBL5028 | O14672 | ADAM10 | 89.09% | 97.50% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 88.62% | 94.97% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 86.33% | 95.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.68% | 91.07% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.59% | 89.34% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 84.57% | 92.29% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 84.57% | 88.42% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.20% | 97.14% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 83.89% | 80.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.33% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.09% | 89.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.45% | 91.24% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.28% | 89.50% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.83% | 97.53% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.70% | 95.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.35% | 99.15% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.16% | 100.00% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 81.02% | 92.50% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 81.02% | 87.67% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.78% | 93.10% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.76% | 94.73% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.58% | 97.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.35% | 91.19% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.06% | 94.23% |
| CHEMBL3891 | P07384 | Calpain 1 | 80.05% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16132070 |
| LOTUS | LTS0170428 |
| wikiData | Q105104682 |