methyl 3-[(3S,6R,9Z,12S,15S,16R)-9-ethylidene-15-[[(2R)-3-(4-hydroxyphenyl)-2-[[(2S)-3-methyl-2-[[(E)-2-methylbut-2-enoyl]amino]butanoyl]amino]propanoyl]amino]-12,16-dimethyl-3-(2-methylpropyl)-2,5,8,11,14-pentaoxo-1-oxa-4,7,10,13-tetrazacyclohexadec-6-yl]propanoate
| Internal ID | ee92d676-beea-4d54-bdd4-2c589f1f8aa1 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | methyl 3-[(3S,6R,9Z,12S,15S,16R)-9-ethylidene-15-[[(2R)-3-(4-hydroxyphenyl)-2-[[(2S)-3-methyl-2-[[(E)-2-methylbut-2-enoyl]amino]butanoyl]amino]propanoyl]amino]-12,16-dimethyl-3-(2-methylpropyl)-2,5,8,11,14-pentaoxo-1-oxa-4,7,10,13-tetrazacyclohexadec-6-yl]propanoate |
| SMILES (Canonical) | CC=C1C(=O)NC(C(=O)NC(C(=O)OC(C(C(=O)NC(C(=O)N1)C)NC(=O)C(CC2=CC=C(C=C2)O)NC(=O)C(C(C)C)NC(=O)C(=CC)C)C)CC(C)C)CCC(=O)OC |
| SMILES (Isomeric) | C/C=C\1/C(=O)N[C@@H](C(=O)N[C@H](C(=O)O[C@@H]([C@@H](C(=O)N[C@H](C(=O)N1)C)NC(=O)[C@@H](CC2=CC=C(C=C2)O)NC(=O)[C@H](C(C)C)NC(=O)/C(=C/C)/C)C)CC(C)C)CCC(=O)OC |
| InChI | InChI=1S/C42H61N7O12/c1-11-23(7)35(52)48-33(22(5)6)40(57)46-30(20-26-13-15-27(50)16-14-26)39(56)49-34-25(9)61-42(59)31(19-21(3)4)47-38(55)29(17-18-32(51)60-10)45-37(54)28(12-2)44-36(53)24(8)43-41(34)58/h11-16,21-22,24-25,29-31,33-34,50H,17-20H2,1-10H3,(H,43,58)(H,44,53)(H,45,54)(H,46,57)(H,47,55)(H,48,52)(H,49,56)/b23-11+,28-12-/t24-,25+,29+,30+,31-,33-,34-/m0/s1 |
| InChI Key | FRTOBMBIXPFSNI-FWOHXGCFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H61N7O12 |
| Molecular Weight | 856.00 g/mol |
| Exact Mass | 855.43782041 g/mol |
| Topological Polar Surface Area (TPSA) | 277.00 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.40% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.21% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.10% | 91.11% |
| CHEMBL4072 | P07858 | Cathepsin B | 96.97% | 93.67% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.85% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.48% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.11% | 99.17% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 95.08% | 93.10% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.55% | 85.14% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.97% | 83.82% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 93.95% | 91.23% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.35% | 90.08% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.64% | 90.20% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 89.24% | 85.11% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.90% | 97.14% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 88.71% | 90.93% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.37% | 96.90% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.20% | 100.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.17% | 92.88% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.37% | 94.75% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.36% | 93.56% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.55% | 94.80% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.84% | 91.19% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.50% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.47% | 95.56% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 85.42% | 85.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.74% | 89.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.86% | 95.38% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.77% | 98.05% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.21% | 95.89% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.92% | 95.50% |
| CHEMBL3468 | P55210 | Caspase-7 | 81.59% | 95.68% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.48% | 90.24% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.51% | 89.50% |
| CHEMBL3891 | P07384 | Calpain 1 | 80.33% | 93.04% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.03% | 95.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 44606683 |
| LOTUS | LTS0088592 |
| wikiData | Q105000424 |