4,22-Dihydroxy-7-(hydroxymethyl)-17,17,24,24-tetramethyl-8,16-dioxa-3,22,28-triazanonacyclo[23.6.1.01,28.03,26.04,9.010,26.011,23.012,21.015,20]dotriaconta-6,11(23),12(21),13,15(20),18-hexaene-2,5,27-trione
| Internal ID | 4eff290c-87b2-436e-82ee-824a8d042963 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Pyrroloquinolines |
| IUPAC Name | 4,22-dihydroxy-7-(hydroxymethyl)-17,17,24,24-tetramethyl-8,16-dioxa-3,22,28-triazanonacyclo[23.6.1.01,28.03,26.04,9.010,26.011,23.012,21.015,20]dotriaconta-6,11(23),12(21),13,15(20),18-hexaene-2,5,27-trione |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC3=C2N(C4=C3C5C6C(C(=O)C=C(O6)CO)(N7C58C(C4(C)C)CC9(C7=O)CCCN9C8=O)O)O)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC3=C2N(C4=C3C5C6C(C(=O)C=C(O6)CO)(N7C58C(C4(C)C)CC9(C7=O)CCCN9C8=O)O)O)C |
| InChI | InChI=1S/C32H33N3O8/c1-28(2)10-8-16-18(43-28)7-6-17-21-22-25-32(40,20(37)12-15(14-36)42-25)35-26(38)30-9-5-11-33(30)27(39)31(22,35)19(13-30)29(3,4)24(21)34(41)23(16)17/h6-8,10,12,19,22,25,36,40-41H,5,9,11,13-14H2,1-4H3 |
| InChI Key | KNGHYNFAEHAHAY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H33N3O8 |
| Molecular Weight | 587.60 g/mol |
| Exact Mass | 587.22676502 g/mol |
| Topological Polar Surface Area (TPSA) | 142.00 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.57% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 98.48% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.42% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.99% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.01% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.41% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.10% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.55% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.42% | 97.09% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 88.38% | 95.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.56% | 93.40% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.12% | 93.04% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.54% | 99.23% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.23% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.10% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.88% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.31% | 95.89% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 82.77% | 97.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.18% | 86.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.83% | 97.14% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.48% | 90.24% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.87% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162814979 |
| LOTUS | LTS0135335 |
| wikiData | Q104170439 |