[3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 7-(acetyloxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6-tetrahydrocyclopenta[c]pyran-4-carboxylate
| Internal ID | d0bd1366-038d-4394-8415-d7d004b00193 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 7-(acetyloxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES (Canonical) | CC(=O)OCC1=C2C(CC1)C(=COC2OC3C(C(C(C(O3)CO)O)O)O)C(=O)OC4C(C(C(C(O4)CO)O)O)O |
| SMILES (Isomeric) | CC(=O)OCC1=C2C(CC1)C(=COC2OC3C(C(C(C(O3)CO)O)O)O)C(=O)OC4C(C(C(C(O4)CO)O)O)O |
| InChI | InChI=1S/C24H34O16/c1-8(27)35-6-9-2-3-10-11(21(34)39-23-19(32)17(30)15(28)12(4-25)37-23)7-36-22(14(9)10)40-24-20(33)18(31)16(29)13(5-26)38-24/h7,10,12-13,15-20,22-26,28-33H,2-6H2,1H3 |
| InChI Key | JDNHEAUTUCBEGD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H34O16 |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 578.18468499 g/mol |
| Topological Polar Surface Area (TPSA) | 251.00 Ų |
| XlogP | -4.10 |
| There are no found synonyms. |
![2D Structure of [3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 7-(acetyloxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6-tetrahydrocyclopenta[c]pyran-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/d4419e80-86cd-11ee-b83e-3b6d53dadd07.jpg "2D Structure of [3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 7-(acetyloxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6-tetrahydrocyclopenta[c]pyran-4-carboxylate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.13% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.87% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.60% | 99.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.29% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.53% | 98.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.51% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.27% | 94.73% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.98% | 92.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.34% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.74% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.60% | 100.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.70% | 95.78% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.55% | 96.61% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.33% | 83.82% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.46% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Plantago hookeriana |
| Plantago lanceolata |
| PubChem | 162903646 |
| LOTUS | LTS0130125 |
| wikiData | Q105125605 |