[(2R,3S,4S,5S,6S)-5-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyloxy]oxan-2-yl]oxy-6-[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-3,4-dihydroxyoxan-2-yl]methyl (E)-3-[4-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate
Internal ID | 6a8728c0-e6b4-4740-a900-76277b209a01 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid 3-O-p-coumaroyl glycosides |
IUPAC Name | [(2R,3S,4S,5S,6S)-5-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyloxy]oxan-2-yl]oxy-6-[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-3,4-dihydroxyoxan-2-yl]methyl (E)-3-[4-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C=CC(=O)OC2C(C(COC2OC3C(C(C(OC3OC4=C([O+]=C5C=C(C=C(C5=C4)OC6C(C(C(C(O6)CO)O)O)O)O)C7=CC(=C(C=C7)O)O)COC(=O)C=CC8=CC=C(C=C8)OC9C(C(C(C(O9)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C=CC(=O)O[C@@H]2[C@H]([C@@H](CO[C@H]2O[C@H]3[C@H]([C@@H]([C@H](O[C@H]3OC4=C([O+]=C5C=C(C=C(C5=C4)O[C@H]6[C@H]([C@@H]([C@@H]([C@H](O6)CO)O)O)O)O)C7=CC(=C(C=C7)O)O)COC(=O)/C=C/C8=CC=C(C=C8)O[C@H]9[C@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C58H64O31/c1-77-34-13-24(14-35(78-2)43(34)68)6-12-41(66)88-53-42(67)31(64)21-80-57(53)89-54-49(74)46(71)39(22-79-40(65)11-5-23-3-8-27(9-4-23)81-55-50(75)47(72)44(69)37(19-59)85-55)87-58(54)84-36-18-28-32(82-52(36)25-7-10-29(62)30(63)15-25)16-26(61)17-33(28)83-56-51(76)48(73)45(70)38(20-60)86-56/h3-18,31,37-39,42,44-51,53-60,64,67,69-76H,19-22H2,1-2H3,(H3-,61,62,63,66,68)/p+1/b11-5+/t31-,37-,38-,39-,42+,44-,45-,46-,47+,48-,49+,50+,51+,53-,54+,55-,56-,57+,58-/m1/s1 |
InChI Key | QPUCGPFRKWVURQ-SLWMWEMUSA-O |
Popularity | 0 references in papers |
Molecular Formula | C58H65O31+ |
Molecular Weight | 1258.10 g/mol |
Exact Mass | 1257.35098027 g/mol |
Topological Polar Surface Area (TPSA) | 470.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.81% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.54% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.08% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 98.07% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.05% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.42% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.60% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.31% | 95.56% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.05% | 95.93% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.46% | 99.15% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.81% | 92.94% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.65% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.77% | 90.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.55% | 97.36% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.51% | 86.92% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.44% | 94.00% |
CHEMBL3194 | P02766 | Transthyretin | 88.39% | 90.71% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 87.79% | 80.78% |
CHEMBL2581 | P07339 | Cathepsin D | 87.72% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.66% | 92.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.57% | 94.45% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 87.16% | 92.68% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.09% | 94.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.95% | 90.17% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.94% | 89.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.70% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.42% | 94.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.99% | 94.73% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.93% | 95.83% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.77% | 92.50% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.71% | 97.28% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.12% | 95.50% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 83.04% | 85.31% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.16% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arabidopsis thaliana |
PubChem | 163195463 |
LOTUS | LTS0148496 |
wikiData | Q23462550 |