[6-[[2-(3,4-Dihydroxyphenyl)-5-hydroxy-4-oxo-2,3-dihydrochromen-7-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 3d33ac00-8057-4ae2-952e-f1bd67875f86 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [6-[[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-2,3-dihydrochromen-7-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C(C(C(O3)COC(=O)C=CC4=CC=C(C=C4)O)O)O)O)C5=CC(=C(C=C5)O)O |
SMILES (Isomeric) | C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C(C(C(O3)COC(=O)C=CC4=CC=C(C=C4)O)O)O)O)C5=CC(=C(C=C5)O)O |
InChI | InChI=1S/C30H28O13/c31-16-5-1-14(2-6-16)3-8-25(36)40-13-24-27(37)28(38)29(39)30(43-24)41-17-10-20(34)26-21(35)12-22(42-23(26)11-17)15-4-7-18(32)19(33)9-15/h1-11,22,24,27-34,37-39H,12-13H2 |
InChI Key | OGVBUVNWHBXNFL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H28O13 |
Molecular Weight | 596.50 g/mol |
Exact Mass | 596.15299094 g/mol |
Topological Polar Surface Area (TPSA) | 213.00 Ų |
XlogP | 2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.77% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.24% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.93% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.33% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.90% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.72% | 94.45% |
CHEMBL3194 | P02766 | Transthyretin | 92.71% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.60% | 90.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.32% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.33% | 99.15% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.25% | 95.89% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.85% | 94.80% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.55% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.51% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.60% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 86.24% | 98.95% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 85.08% | 92.68% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.75% | 94.73% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.42% | 95.93% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.37% | 92.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.30% | 99.23% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.13% | 91.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.84% | 90.71% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.37% | 83.82% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.48% | 86.92% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.31% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllanthus emblica |
PubChem | 74819394 |
LOTUS | LTS0102542 |
wikiData | Q105191882 |