(2R,3S,4R,4aR,8aR)-8-(hydroxymethyl)-4-[2-[(3R,5R)-5-methoxyoxolan-3-yl]ethyl]-3,4,8a-trimethyl-1,2,3,4a,5,6-hexahydronaphthalen-2-ol
| Internal ID | 63f5f095-4792-44cb-a25f-c715536b98f3 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Colensane and clerodane diterpenoids |
| IUPAC Name | (2R,3S,4R,4aR,8aR)-8-(hydroxymethyl)-4-[2-[(3R,5R)-5-methoxyoxolan-3-yl]ethyl]-3,4,8a-trimethyl-1,2,3,4a,5,6-hexahydronaphthalen-2-ol |
| SMILES (Canonical) | CC1C(CC2(C(C1(C)CCC3CC(OC3)OC)CCC=C2CO)C)O |
| SMILES (Isomeric) | C[C@@H]1[C@@H](C[C@@]2([C@@H]([C@@]1(C)CC[C@@H]3C[C@@H](OC3)OC)CCC=C2CO)C)O |
| InChI | InChI=1S/C21H36O4/c1-14-17(23)11-21(3)16(12-22)6-5-7-18(21)20(14,2)9-8-15-10-19(24-4)25-13-15/h6,14-15,17-19,22-23H,5,7-13H2,1-4H3/t14-,15-,17-,18-,19-,20+,21+/m1/s1 |
| InChI Key | GOCXWVDTBKRQRK-RCCKSBRTSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.26135963 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of (2R,3S,4R,4aR,8aR)-8-(hydroxymethyl)-4-[2-[(3R,5R)-5-methoxyoxolan-3-yl]ethyl]-3,4,8a-trimethyl-1,2,3,4a,5,6-hexahydronaphthalen-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/d3a218c0-861d-11ee-918d-6fc38f0304eb.jpg "2D Structure of (2R,3S,4R,4aR,8aR)-8-(hydroxymethyl)-4-[2-[(3R,5R)-5-methoxyoxolan-3-yl]ethyl]-3,4,8a-trimethyl-1,2,3,4a,5,6-hexahydronaphthalen-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.90% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.47% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.44% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.57% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.96% | 94.45% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.95% | 95.93% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.91% | 97.79% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.67% | 95.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.34% | 97.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.99% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.95% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.24% | 86.33% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.12% | 92.62% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.88% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Baccharis articulata |
| Baccharis gaudichaudiana |
| Baccharis sagittalis |
| PubChem | 163070117 |
| LOTUS | LTS0122691 |
| wikiData | Q105013723 |