[(1R,8S,9S,10S,13S)-6,9,10-trimethyl-2-oxo-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-8-yl] 2-methylprop-2-enoate
Internal ID | 725185ae-4379-4691-b09a-15fd2625c114 |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | [(1R,8S,9S,10S,13S)-6,9,10-trimethyl-2-oxo-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-8-yl] 2-methylprop-2-enoate |
SMILES (Canonical) | CC1CCC2C3(C1(C(C4=C(C3=O)OC=C4C)OC(=O)C(=C)C)C)O2 |
SMILES (Isomeric) | C[C@H]1CC[C@H]2[C@@]3([C@@]1([C@@H](C4=C(C3=O)OC=C4C)OC(=O)C(=C)C)C)O2 |
InChI | InChI=1S/C19H22O5/c1-9(2)17(21)23-16-13-10(3)8-22-14(13)15(20)19-12(24-19)7-6-11(4)18(16,19)5/h8,11-12,16H,1,6-7H2,2-5H3/t11-,12-,16+,18-,19+/m0/s1 |
InChI Key | XEYJLCKQLFSWLD-KWCTYANWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H22O5 |
Molecular Weight | 330.40 g/mol |
Exact Mass | 330.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 69.00 Ų |
XlogP | 3.40 |
There are no found synonyms. |
![2D Structure of [(1R,8S,9S,10S,13S)-6,9,10-trimethyl-2-oxo-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-8-yl] 2-methylprop-2-enoate 2D Structure of [(1R,8S,9S,10S,13S)-6,9,10-trimethyl-2-oxo-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-8-yl] 2-methylprop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/d39d53f0-8664-11ee-a580-6b4d5b17c885.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.21% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.11% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.54% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.47% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.98% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.81% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.58% | 91.19% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.49% | 96.43% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.49% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.10% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 82.41% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.35% | 94.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.25% | 92.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.33% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euryops linifolius |
PubChem | 14237562 |
LOTUS | LTS0275008 |
wikiData | Q105326836 |