(1R,3S,3aR,5aS,5bS,6S,7aS,11aS,13aR,13bR)-1,6-dihydroxy-3a-(hydroxymethyl)-5a,8,8,11a,13a-pentamethyl-3-propan-2-yl-2,3,4,5,5b,6,7,7a,10,11,13,13b-dodecahydro-1H-cyclopenta[a]chrysen-9-one
Internal ID | 5a3f7a35-c2ce-47f1-995f-88255809fcde |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1R,3S,3aR,5aS,5bS,6S,7aS,11aS,13aR,13bR)-1,6-dihydroxy-3a-(hydroxymethyl)-5a,8,8,11a,13a-pentamethyl-3-propan-2-yl-2,3,4,5,5b,6,7,7a,10,11,13,13b-dodecahydro-1H-cyclopenta[a]chrysen-9-one |
SMILES (Canonical) | CC(C)C1CC(C2C1(CCC3(C2(CC=C4C3C(CC5C4(CCC(=O)C5(C)C)C)O)C)C)CO)O |
SMILES (Isomeric) | CC(C)[C@@H]1C[C@H]([C@H]2[C@]1(CC[C@@]3([C@@]2(CC=C4[C@H]3[C@H](C[C@H]5[C@@]4(CCC(=O)C5(C)C)C)O)C)C)CO)O |
InChI | InChI=1S/C30H48O4/c1-17(2)19-14-21(33)25-29(7)11-8-18-24(28(29,6)12-13-30(19,25)16-31)20(32)15-22-26(3,4)23(34)9-10-27(18,22)5/h8,17,19-22,24-25,31-33H,9-16H2,1-7H3/t19-,20-,21+,22+,24-,25+,27+,28-,29+,30+/m0/s1 |
InChI Key | BNCWPGHWXAEYNK-KHEOSNOKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O4 |
Molecular Weight | 472.70 g/mol |
Exact Mass | 472.35526001 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 4.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 95.56% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.71% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.61% | 96.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 92.94% | 97.79% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.09% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.00% | 94.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.83% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.60% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.34% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.12% | 97.25% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 88.06% | 95.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.19% | 82.69% |
CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 85.05% | 95.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.66% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.46% | 99.23% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.79% | 95.93% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.06% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rubia yunnanensis |
PubChem | 162923307 |
LOTUS | LTS0255769 |
wikiData | Q104938723 |