(2R,3R,4R,5R,6S)-2-[[(3R,8S,9S,10R,11R,13S,14S,16S,17S)-3,11-dihydroxy-17-[(2S,3S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-methyloxane-3,4,5-triol
Internal ID | fd69a586-a8db-4857-b96c-1622fda06950 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | (2R,3R,4R,5R,6S)-2-[[(3R,8S,9S,10R,11R,13S,14S,16S,17S)-3,11-dihydroxy-17-[(2S,3S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CC3C4CC=C5CC(CCC5(C4C(CC3(C2C(C)C(CCC(C)C)O)C)O)C)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2C[C@H]3[C@@H]4CC=C5C[C@@H](CC[C@@]5([C@H]4[C@@H](C[C@@]3([C@@H]2[C@H](C)[C@H](CCC(C)C)O)C)O)C)O)O)O)O |
InChI | InChI=1S/C33H56O8/c1-16(2)7-10-23(35)17(3)26-25(41-31-30(39)29(38)28(37)18(4)40-31)14-22-21-9-8-19-13-20(34)11-12-32(19,5)27(21)24(36)15-33(22,26)6/h8,16-18,20-31,34-39H,7,9-15H2,1-6H3/t17-,18+,20-,21+,22+,23+,24-,25+,26-,27-,28+,29-,30-,31+,32+,33+/m1/s1 |
InChI Key | YCZAEBFSTKVRIP-WEJUMZFGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H56O8 |
Molecular Weight | 580.80 g/mol |
Exact Mass | 580.39751874 g/mol |
Topological Polar Surface Area (TPSA) | 140.00 Ų |
XlogP | 3.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.37% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.22% | 95.93% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.64% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.83% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.89% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.56% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.94% | 95.89% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 91.93% | 98.05% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.80% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.46% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.85% | 86.33% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 89.36% | 94.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.90% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.33% | 95.89% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.91% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.79% | 94.73% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.67% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.43% | 90.71% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.32% | 89.05% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.17% | 97.79% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 86.14% | 97.56% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.96% | 93.56% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 85.15% | 98.59% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.60% | 97.14% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.34% | 97.33% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.24% | 92.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ornithogalum saundersiae |
PubChem | 163195592 |
LOTUS | LTS0172717 |
wikiData | Q105346606 |