6a-[[3-[(4a-Carboxy-10-hydroxy-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-6a-yl)methoxycarbonyl]-1-(3,4-dihydroxyphenyl)-7,8-dihydroxy-1,2-dihydronaphthalene-2-carbonyl]oxymethyl]-10-hydroxy-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
| Internal ID | 74a62e9e-199b-421d-a1b9-66ba1530941c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | 6a-[[3-[(4a-carboxy-10-hydroxy-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-6a-yl)methoxycarbonyl]-1-(3,4-dihydroxyphenyl)-7,8-dihydroxy-1,2-dihydronaphthalene-2-carbonyl]oxymethyl]-10-hydroxy-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C2C1)COC(=O)C6C(C7=C(C=CC(=C7O)O)C=C6C(=O)OCC89CCC1(CCC(CC1C8=CCC1C9(CCC2C1(CCC(C2(C)C)O)C)C)(C)C)C(=O)O)C1=CC(=C(C=C1)O)O)C(=O)O)C |
| SMILES (Isomeric) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C2C1)COC(=O)C6C(C7=C(C=CC(=C7O)O)C=C6C(=O)OCC89CCC1(CCC(CC1C8=CCC1C9(CCC2C1(CCC(C2(C)C)O)C)C)(C)C)C(=O)O)C1=CC(=C(C=C1)O)O)C(=O)O)C |
| InChI | InChI=1S/C78H106O14/c1-67(2)29-31-75(65(87)88)33-35-77(46(48(75)39-67)15-19-55-71(9)25-23-57(82)69(5,6)53(71)21-27-73(55,77)11)41-91-63(85)45-37-43-14-18-51(80)62(84)60(43)59(44-13-17-50(79)52(81)38-44)61(45)64(86)92-42-78-36-34-76(66(89)90)32-30-68(3,4)40-49(76)47(78)16-20-56-72(10)26-24-58(83)70(7,8)54(72)22-28-74(56,78)12/h13-18,37-38,48-49,53-59,61,79-84H,19-36,39-42H2,1-12H3,(H,87,88)(H,89,90) |
| InChI Key | GBYSCIRCSDUHFU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C78H106O14 |
| Molecular Weight | 1267.70 g/mol |
| Exact Mass | 1266.75825805 g/mol |
| Topological Polar Surface Area (TPSA) | 249.00 Ų |
| XlogP | 15.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.51% | 91.11% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 99.28% | 95.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.32% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.28% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.44% | 94.45% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.52% | 96.38% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.86% | 99.15% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.87% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.44% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.56% | 95.89% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.96% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.65% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.22% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.10% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.79% | 95.93% |
| CHEMBL5028 | O14672 | ADAM10 | 83.26% | 97.50% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.08% | 92.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.16% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.74% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.63% | 89.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.33% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Rhoiptelea chiliantha |
| PubChem | 162912675 |
| LOTUS | LTS0067916 |
| wikiData | Q105006158 |