[4-Acetyloxy-6-(acetyloxymethyl)-2-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | c858db07-9550-4ec2-979b-538fbbaacbdc |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [4-acetyloxy-6-(acetyloxymethyl)-2-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)OC(=O)C=CC5=CC=C(C=C5)O)OC(=O)C)OC(=O)C=CC6=CC(=C(C=C6)O)OC |
SMILES (Isomeric) | CC(=O)OCC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)OC(=O)C=CC5=CC=C(C=C5)O)OC(=O)C)OC(=O)C=CC6=CC(=C(C=C6)O)OC |
InChI | InChI=1S/C44H38O18/c1-22(45)56-21-34-40(60-35(52)17-8-25-6-15-30(50)32(18-25)55-3)42(57-23(2)46)43(61-36(53)16-7-24-4-11-27(47)12-5-24)44(59-34)62-41-38(54)37-31(51)19-29(49)20-33(37)58-39(41)26-9-13-28(48)14-10-26/h4-20,34,40,42-44,47-51H,21H2,1-3H3 |
InChI Key | ZMJHGBYPYRHSST-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H38O18 |
Molecular Weight | 854.80 g/mol |
Exact Mass | 854.20581436 g/mol |
Topological Polar Surface Area (TPSA) | 260.00 Ų |
XlogP | 5.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.51% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.57% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.99% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.66% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.53% | 85.14% |
CHEMBL3194 | P02766 | Transthyretin | 95.34% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.42% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.95% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.73% | 96.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 92.43% | 95.64% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.30% | 95.50% |
CHEMBL2581 | P07339 | Cathepsin D | 90.91% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.87% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.44% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.12% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.22% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.87% | 94.00% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 86.14% | 97.03% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.37% | 90.00% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 84.31% | 88.48% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.93% | 96.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.90% | 89.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.78% | 95.89% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.72% | 95.78% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.40% | 91.19% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.30% | 97.28% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.29% | 92.62% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.22% | 94.80% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.18% | 94.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.09% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Quercus incana |
PubChem | 162870322 |
LOTUS | LTS0030038 |
wikiData | Q105379481 |