8-[5-[4-Hydroxy-5-[4-methoxy-6-methyl-5-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-5,19-dimethyl-15,18,20-trioxapentacyclo[14.5.1.04,13.05,10.019,22]docosa-1(21),10-dien-14-one
| Internal ID | b6b93c25-8d14-4797-bdac-1dffcad7d1f8 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | 8-[5-[4-hydroxy-5-[4-methoxy-6-methyl-5-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-5,19-dimethyl-15,18,20-trioxapentacyclo[14.5.1.04,13.05,10.019,22]docosa-1(21),10-dien-14-one |
| SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3CCC4(C5CCC6=COC7(C6C(CO7)OC(=O)C5CC=C4C3)C)C)C)O)OC8CC(C(C(O8)C)OC9C(C(C(C(O9)COC1C(C(C(C(O1)CO)O)O)O)O)O)O)OC |
| SMILES (Isomeric) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3CCC4(C5CCC6=COC7(C6C(CO7)OC(=O)C5CC=C4C3)C)C)C)O)OC8CC(C(C(O8)C)OC9C(C(C(C(O9)COC1C(C(C(C(O1)CO)O)O)O)O)O)O)OC |
| InChI | InChI=1S/C53H82O24/c1-22-46(75-38-17-32(64-7)48(24(3)70-38)77-51-45(61)43(59)41(57)35(74-51)20-65-50-44(60)42(58)40(56)33(18-54)73-50)30(55)15-36(68-22)76-47-23(2)69-37(16-31(47)63-6)71-27-12-13-52(4)26(14-27)9-10-28-29(52)11-8-25-19-66-53(5)39(25)34(21-67-53)72-49(28)62/h9,19,22-24,27-48,50-51,54-61H,8,10-18,20-21H2,1-7H3 |
| InChI Key | BJLXLLOVBLKQLF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C53H82O24 |
| Molecular Weight | 1103.20 g/mol |
| Exact Mass | 1102.51960348 g/mol |
| Topological Polar Surface Area (TPSA) | 317.00 Ų |
| XlogP | -1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.35% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.26% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.06% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.59% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.57% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.40% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.37% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.95% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.71% | 89.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.04% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.82% | 94.00% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 88.05% | 95.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.89% | 95.93% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.33% | 92.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.72% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.37% | 95.56% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.98% | 94.33% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.97% | 97.33% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.30% | 97.79% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.06% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.45% | 92.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.81% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.44% | 95.50% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.10% | 96.43% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.89% | 86.92% |
| CHEMBL5028 | O14672 | ADAM10 | 81.64% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vincetoxicum forrestii |
| PubChem | 73797147 |
| LOTUS | LTS0100893 |
| wikiData | Q104937168 |