[(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,8-dihydroxy-7-methoxy-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 589a0035-e8bc-46fc-b182-45215b49c863 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid 3-O-p-coumaroyl glycosides |
IUPAC Name | [(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,8-dihydroxy-7-methoxy-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=C(C2=C(C(=C1)O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)OC4C(C(C(C(O4)COC(=O)C=CC5=CC=C(C=C5)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C2=C(C(=C1)O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)/C=C/C5=CC=C(C=C5)O)O)O)O)O |
InChI | InChI=1S/C31H28O15/c1-42-19-11-18(35)22-25(39)30(28(45-29(22)24(19)38)14-5-8-16(33)17(34)10-14)46-31-27(41)26(40)23(37)20(44-31)12-43-21(36)9-4-13-2-6-15(32)7-3-13/h2-11,20,23,26-27,31-35,37-38,40-41H,12H2,1H3/b9-4+/t20-,23-,26+,27-,31+/m1/s1 |
InChI Key | SMQJRRCPGGOYKT-JYTUTVMXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H28O15 |
Molecular Weight | 640.50 g/mol |
Exact Mass | 640.14282018 g/mol |
Topological Polar Surface Area (TPSA) | 242.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,8-dihydroxy-7-methoxy-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,8-dihydroxy-7-methoxy-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/d316bb30-856c-11ee-a642-252e27f56995.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.80% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.13% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.09% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.39% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.53% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 94.27% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.68% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.43% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.61% | 98.95% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.30% | 95.64% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.67% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.86% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.25% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.74% | 94.00% |
CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 85.77% | 98.21% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.40% | 95.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.29% | 94.73% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 84.22% | 80.78% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.02% | 89.62% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.77% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.61% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.44% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.73% | 91.49% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.07% | 95.78% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.07% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Philotheca rhomboidea |
PubChem | 102513344 |
LOTUS | LTS0042244 |
wikiData | Q105256100 |