[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (3S,4S,5R,6R,8R,9R,10R,13S,14S,15R)-6-hydroxy-4-(3-methoxy-3-oxopropyl)-4,9,10-trimethyl-3,15-bis(prop-1-en-2-yl)-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylate
Internal ID | d1255d8c-458c-4201-8fa9-ac13186563d1 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (3S,4S,5R,6R,8R,9R,10R,13S,14S,15R)-6-hydroxy-4-(3-methoxy-3-oxopropyl)-4,9,10-trimethyl-3,15-bis(prop-1-en-2-yl)-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC(=O)C45CCC(C4C6CC(C7C(C6(CC5)C)(CCC(C7(C)CCC(=O)OC)C(=C)C)C)O)C(=C)C)O)O)O)CO)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)OC(=O)[C@]45CC[C@H]([C@H]4[C@H]6C[C@H]([C@H]7[C@]([C@@]6(CC5)C)(CC[C@H]([C@]7(C)CCC(=O)OC)C(=C)C)C)O)C(=C)C)O)O)O)CO)O)O)O |
InChI | InChI=1S/C49H78O19/c1-21(2)24-10-15-49(17-16-47(7)26(31(24)49)18-27(51)41-46(6,13-12-30(52)62-9)25(22(3)4)11-14-48(41,47)8)45(61)68-44-38(59)35(56)33(54)29(66-44)20-63-42-39(60)36(57)40(28(19-50)65-42)67-43-37(58)34(55)32(53)23(5)64-43/h23-29,31-44,50-51,53-60H,1,3,10-20H2,2,4-9H3/t23-,24-,25-,26+,27+,28+,29+,31-,32-,33+,34+,35-,36+,37+,38+,39+,40+,41+,42+,43-,44-,46-,47+,48+,49-/m0/s1 |
InChI Key | MOOLZJWTQXQPQL-HODPKVNCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C49H78O19 |
Molecular Weight | 971.10 g/mol |
Exact Mass | 970.51373025 g/mol |
Topological Polar Surface Area (TPSA) | 301.00 Ų |
XlogP | 1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.59% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.30% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.29% | 97.25% |
CHEMBL233 | P35372 | Mu opioid receptor | 96.07% | 97.93% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.99% | 96.61% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.66% | 95.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.08% | 97.09% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 90.93% | 95.83% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.66% | 92.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.44% | 94.45% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 90.31% | 97.79% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.43% | 86.33% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.18% | 91.24% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.47% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.10% | 94.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.45% | 91.19% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.43% | 96.43% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.39% | 96.90% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.31% | 94.80% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.22% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.02% | 85.14% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.87% | 97.33% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.17% | 95.71% |
CHEMBL5028 | O14672 | ADAM10 | 83.17% | 97.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.91% | 97.36% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.91% | 96.77% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.90% | 89.05% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.46% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 82.40% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.86% | 92.94% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.80% | 96.38% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.55% | 97.53% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.45% | 95.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.39% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.10% | 91.07% |
CHEMBL2094128 | P24941 | Cyclin-dependent kinase 2/cyclin A | 81.01% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eleutherococcus senticosus |
PubChem | 162912641 |
LOTUS | LTS0077701 |
wikiData | Q105169034 |