17-(5-ethyl-6-methylhept-6-en-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol
Internal ID | 62525f45-3c15-4479-b2cb-4b48dc0ecdaa |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | 17-(5-ethyl-6-methylhept-6-en-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
SMILES (Canonical) | CCC(CCC(C)C1CCC2C1(CCC3C2C(C=C4C3(CCC(C4)O)C)O)C)C(=C)C |
SMILES (Isomeric) | CCC(CCC(C)C1CCC2C1(CCC3C2C(C=C4C3(CCC(C4)O)C)O)C)C(=C)C |
InChI | InChI=1S/C29H48O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-27-25(13-15-29(23,24)6)28(5)14-12-22(30)16-21(28)17-26(27)31/h17,19-20,22-27,30-31H,2,7-16H2,1,3-6H3 |
InChI Key | MNIVAEKDEDQBEP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H48O2 |
Molecular Weight | 428.70 g/mol |
Exact Mass | 428.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 8.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.50% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.91% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.72% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 93.05% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.22% | 90.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.18% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.80% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.09% | 91.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.23% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.87% | 90.71% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.51% | 93.04% |
CHEMBL233 | P35372 | Mu opioid receptor | 87.12% | 97.93% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 86.09% | 94.66% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.01% | 93.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.40% | 97.09% |
CHEMBL237 | P41145 | Kappa opioid receptor | 84.36% | 98.10% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.96% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.59% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.33% | 96.43% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 80.31% | 94.50% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.31% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica charantia |
PubChem | 73082431 |
LOTUS | LTS0045802 |
wikiData | Q105168388 |