[(2S,3S,4R,5R)-2-[(2R,3R,4S,5R,6R)-4-[(2S,3R,4S,5S,6R)-6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-5-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-2-[[(E)-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoyl]oxymethyl]-5-(hydroxymethyl)oxolan-3-yl] benzoate
Internal ID | f3f13e33-6c0b-49c8-9f6c-be98c3dc841b |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3S,4R,5R)-2-[(2R,3R,4S,5R,6R)-4-[(2S,3R,4S,5S,6R)-6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-5-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-2-[[(E)-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoyl]oxymethyl]-5-(hydroxymethyl)oxolan-3-yl] benzoate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)O)OC4(C(C(C(O4)CO)O)OC(=O)C5=CC=CC=C5)COC(=O)C=CC6=C(C=C(C=C6)O)OC)CO)OC(=O)C=CC7=CC(=C(C=C7)O)OC)O)O)O |
SMILES (Isomeric) | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@H]2[C@@H]([C@H](O[C@@H]([C@@H]2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O[C@]4([C@H]([C@@H]([C@H](O4)CO)O)OC(=O)C5=CC=CC=C5)COC(=O)/C=C/C6=C(C=C(C=C6)O)OC)CO)OC(=O)/C=C/C7=CC(=C(C=C7)O)OC)O)O)O |
InChI | InChI=1S/C53H64O29/c1-24(57)72-22-35-39(63)42(66)44(68)51(76-35)78-46-45(77-37(61)15-10-25-9-14-29(59)31(17-25)71-3)34(21-56)75-52(47(46)79-50-43(67)41(65)38(62)32(19-54)74-50)82-53(23-73-36(60)16-12-26-11-13-28(58)18-30(26)70-2)48(40(64)33(20-55)81-53)80-49(69)27-7-5-4-6-8-27/h4-18,32-35,38-48,50-52,54-56,58-59,62-68H,19-23H2,1-3H3/b15-10+,16-12+/t32-,33-,34-,35-,38-,39-,40-,41+,42+,43-,44-,45-,46+,47-,48+,50+,51+,52-,53+/m1/s1 |
InChI Key | JNIFKNHXMVUVDN-BRGCUJIISA-N |
Popularity | 0 references in papers |
Molecular Formula | C53H64O29 |
Molecular Weight | 1165.10 g/mol |
Exact Mass | 1164.35332600 g/mol |
Topological Polar Surface Area (TPSA) | 431.00 Ų |
XlogP | -1.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 99.40% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.64% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.87% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.85% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.58% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.01% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.15% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 92.89% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.61% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 91.89% | 98.95% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.48% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.15% | 94.73% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.46% | 91.19% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.05% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.09% | 90.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.28% | 95.83% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.68% | 95.89% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.48% | 83.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.97% | 94.62% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.06% | 94.08% |
CHEMBL5028 | O14672 | ADAM10 | 82.67% | 97.50% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.83% | 91.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.80% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polygala fallax |
Polygala senega |
Polygala wattersii |
PubChem | 11968936 |
LOTUS | LTS0130724 |
wikiData | Q105131921 |