(E)-N-[(2R)-2-[4-[(2E,6E)-3,7-dimethyl-8-oxoocta-2,6-dienoxy]phenyl]-2-hydroxyethyl]-3-methylsulfonylprop-2-enamide
| Internal ID | b7ef042a-8523-4c8a-8de6-8f0606369bf9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Aromatic monoterpenoids |
| IUPAC Name | (E)-N-[(2R)-2-[4-[(2E,6E)-3,7-dimethyl-8-oxoocta-2,6-dienoxy]phenyl]-2-hydroxyethyl]-3-methylsulfonylprop-2-enamide |
| SMILES (Canonical) | CC(=CCOC1=CC=C(C=C1)C(CNC(=O)C=CS(=O)(=O)C)O)CCC=C(C)C=O |
| SMILES (Isomeric) | C/C(=C\COC1=CC=C(C=C1)[C@H](CNC(=O)/C=C/S(=O)(=O)C)O)/CC/C=C(\C)/C=O |
| InChI | InChI=1S/C22H29NO6S/c1-17(5-4-6-18(2)16-24)11-13-29-20-9-7-19(8-10-20)21(25)15-23-22(26)12-14-30(3,27)28/h6-12,14,16,21,25H,4-5,13,15H2,1-3H3,(H,23,26)/b14-12+,17-11+,18-6+/t21-/m0/s1 |
| InChI Key | ZHYIPTBPSLKFJK-DKOGWASHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H29NO6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.17155882 g/mol |
| Topological Polar Surface Area (TPSA) | 118.00 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
![2D Structure of (E)-N-[(2R)-2-[4-[(2E,6E)-3,7-dimethyl-8-oxoocta-2,6-dienoxy]phenyl]-2-hydroxyethyl]-3-methylsulfonylprop-2-enamide](https://plantaedb.com/storage/docs/compounds/2023/11/d2c99e40-8702-11ee-b363-7b3382f5f1c9.jpg "2D Structure of (E)-N-[(2R)-2-[4-[(2E,6E)-3,7-dimethyl-8-oxoocta-2,6-dienoxy]phenyl]-2-hydroxyethyl]-3-methylsulfonylprop-2-enamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2039 | P27338 | Monoamine oxidase B | 98.78% | 92.51% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.83% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.91% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.42% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 95.12% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.32% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.20% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.81% | 91.11% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.35% | 90.24% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 89.20% | 94.00% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 87.27% | 93.81% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.25% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.69% | 90.00% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 82.36% | 89.33% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.46% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycosmis chlorosperma |
| PubChem | 163188630 |
| LOTUS | LTS0068933 |
| wikiData | Q105376115 |