methyl (1S,15R,17S,18S)-17-ethyl-5-[(1S,12R,14S,15E,18S)-15-ethylidene-18-(hydroxymethyl)-18-methoxycarbonyl-17-methyl-10,17-diazatetracyclo[12.3.1.03,11.04,9]octadeca-3(11),4,6,8-tetraen-12-yl]-6-hydroxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-1-carboxylate
| Internal ID | 999ab71b-fc9f-460b-912f-7d643ace94f9 |
| Taxonomy | Alkaloids and derivatives > Ibogan-type alkaloids |
| IUPAC Name | methyl (1S,15R,17S,18S)-17-ethyl-5-[(1S,12R,14S,15E,18S)-15-ethylidene-18-(hydroxymethyl)-18-methoxycarbonyl-17-methyl-10,17-diazatetracyclo[12.3.1.03,11.04,9]octadeca-3(11),4,6,8-tetraen-12-yl]-6-hydroxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-1-carboxylate |
| SMILES (Canonical) | CCC1CC2CC3(C1N(C2)CCC4=C3NC5=C4C=CC(=C5C6CC7C(=CC)CN(C(C7(CO)C(=O)OC)CC8=C6NC9=CC=CC=C89)C)O)C(=O)OC |
| SMILES (Isomeric) | CC[C@H]1C[C@@H]2C[C@@]3([C@H]1N(C2)CCC4=C3NC5=C4C=CC(=C5[C@H]6C[C@H]7/C(=C\C)/CN([C@H]([C@@]7(CO)C(=O)OC)CC8=C6NC9=CC=CC=C89)C)O)C(=O)OC |
| InChI | InChI=1S/C43H52N4O6/c1-6-24-16-23-19-42(40(50)52-4)38-28(14-15-47(20-23)39(24)42)27-12-13-33(49)35(37(27)45-38)30-17-31-25(7-2)21-46(3)34(43(31,22-48)41(51)53-5)18-29-26-10-8-9-11-32(26)44-36(29)30/h7-13,23-24,30-31,34,39,44-45,48-49H,6,14-22H2,1-5H3/b25-7-/t23-,24+,30-,31+,34+,39+,42-,43+/m1/s1 |
| InChI Key | AKMMTZWJQROODJ-GBKBJXDPSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C43H52N4O6 |
| Molecular Weight | 720.90 g/mol |
| Exact Mass | 720.38868539 g/mol |
| Topological Polar Surface Area (TPSA) | 131.00 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.45% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.99% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.81% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.72% | 94.45% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.61% | 83.82% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.40% | 95.56% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 94.94% | 95.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 91.85% | 98.59% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 89.14% | 91.79% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 88.36% | 97.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.33% | 90.00% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 86.47% | 90.95% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 85.49% | 88.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.34% | 97.25% |
| CHEMBL5028 | O14672 | ADAM10 | 85.26% | 97.50% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.20% | 94.08% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.09% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.00% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.90% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.54% | 99.17% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 82.77% | 96.39% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.34% | 98.75% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.36% | 92.86% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.04% | 95.89% |
| CHEMBL233 | P35372 | Mu opioid receptor | 80.76% | 97.93% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 80.61% | 85.83% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.56% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Tabernaemontana corymbosa |
| PubChem | 10941586 |
| LOTUS | LTS0197453 |
| wikiData | Q104913723 |