[9-Hydroxy-5-(4-hydroxy-3-methoxybenzoyl)oxy-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-12-yl] 4-hydroxy-3-methoxybenzoate
| Internal ID | a205dd98-e962-4bc8-ab7e-04f9747b69db |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | [9-hydroxy-5-(4-hydroxy-3-methoxybenzoyl)oxy-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-12-yl] 4-hydroxy-3-methoxybenzoate |
| SMILES (Canonical) | CC(=C)C1CCC2(C1C3CC(C4C5(CCC(C(C5CCC4(C3(C(C2)OC(=O)C6=CC(=C(C=C6)O)OC)C)C)(C)C)O)C)OC(=O)C7=CC(=C(C=C7)O)OC)C |
| SMILES (Isomeric) | CC(=C)C1CCC2(C1C3CC(C4C5(CCC(C(C5CCC4(C3(C(C2)OC(=O)C6=CC(=C(C=C6)O)OC)C)C)(C)C)O)C)OC(=O)C7=CC(=C(C=C7)O)OC)C |
| InChI | InChI=1S/C46H62O9/c1-25(2)28-15-18-43(5)24-37(55-41(51)27-12-14-31(48)33(22-27)53-10)46(8)29(38(28)43)23-34(54-40(50)26-11-13-30(47)32(21-26)52-9)39-44(6)19-17-36(49)42(3,4)35(44)16-20-45(39,46)7/h11-14,21-22,28-29,34-39,47-49H,1,15-20,23-24H2,2-10H3 |
| InChI Key | KXJAZRZJROOYLF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C46H62O9 |
| Molecular Weight | 759.00 g/mol |
| Exact Mass | 758.43938355 g/mol |
| Topological Polar Surface Area (TPSA) | 132.00 Ų |
| XlogP | 10.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.20% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.30% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 95.39% | 92.94% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.91% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.55% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.23% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.91% | 91.19% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.25% | 82.69% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.64% | 90.17% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.53% | 100.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 87.76% | 90.24% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.67% | 98.75% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.04% | 89.62% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.22% | 92.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.65% | 94.00% |
| CHEMBL3194 | P02766 | Transthyretin | 85.44% | 90.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.26% | 96.95% |
| CHEMBL3983 | P33981 | Dual specificity protein kinase TTK | 84.57% | 98.99% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.35% | 97.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.27% | 95.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.72% | 97.21% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.35% | 93.03% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.13% | 91.07% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.87% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.39% | 89.00% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.94% | 97.33% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.05% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ulmus davidiana var. japonica |
| PubChem | 73808511 |
| LOTUS | LTS0085515 |
| wikiData | Q105147363 |