7-(Furan-3-yl)-15-hydroxy-1,8,12,16,16-pentamethyl-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadecane-5,19-dione
Internal ID | 67ed72b4-c0cf-44ef-84fe-3a297d3db16c |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | 7-(furan-3-yl)-15-hydroxy-1,8,12,16,16-pentamethyl-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadecane-5,19-dione |
SMILES (Canonical) | CC1(C(CCC2(C1CC(=O)C3(C2CCC4(C35C(O5)C(=O)OC4C6=COC=C6)C)C)C)O)C |
SMILES (Isomeric) | CC1(C(CCC2(C1CC(=O)C3(C2CCC4(C35C(O5)C(=O)OC4C6=COC=C6)C)C)C)O)C |
InChI | InChI=1S/C26H34O6/c1-22(2)16-12-18(28)25(5)15(23(16,3)9-7-17(22)27)6-10-24(4)19(14-8-11-30-13-14)31-21(29)20-26(24,25)32-20/h8,11,13,15-17,19-20,27H,6-7,9-10,12H2,1-5H3 |
InChI Key | PHTAMFNWUKAAAC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H34O6 |
Molecular Weight | 442.50 g/mol |
Exact Mass | 442.23553880 g/mol |
Topological Polar Surface Area (TPSA) | 89.30 Ų |
XlogP | 3.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.01% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.66% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.41% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.10% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.62% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 86.86% | 98.95% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.64% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.32% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.36% | 89.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.97% | 82.69% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 83.87% | 92.97% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.81% | 85.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.24% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.83% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.41% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.91% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.12% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cedrela fissilis |
PubChem | 73026677 |
LOTUS | LTS0246146 |
wikiData | Q104194776 |