methyl (1S,4aS,6S,7R,7aS)-6-[(2E,6S)-6-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2,6-dimethylocta-2,7-dienoyl]oxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
Internal ID | 27250240-e065-43fa-9774-eefc7f683aa5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1S,4aS,6S,7R,7aS)-6-[(2E,6S)-6-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2,6-dimethylocta-2,7-dienoyl]oxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1C(CC2C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O)OC(=O)C(=CCCC(C)(C=C)OC4C(C(C(C(O4)COC5C(C(CO5)(CO)O)O)O)O)O)C |
SMILES (Isomeric) | C[C@H]1[C@H](C[C@H]2[C@@H]1[C@@H](OC=C2C(=O)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)OC(=O)/C(=C/CC[C@@](C)(C=C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO[C@H]5[C@@H]([C@](CO5)(CO)O)O)O)O)O)/C |
InChI | InChI=1S/C38H58O21/c1-6-37(4,59-35-29(46)27(44)25(42)22(57-35)13-53-36-30(47)38(50,14-40)15-54-36)9-7-8-16(2)31(48)55-20-10-18-19(32(49)51-5)12-52-33(23(18)17(20)3)58-34-28(45)26(43)24(41)21(11-39)56-34/h6,8,12,17-18,20-30,33-36,39-47,50H,1,7,9-11,13-15H2,2-5H3/b16-8+/t17-,18+,20-,21+,22+,23+,24+,25+,26-,27-,28+,29+,30-,33-,34-,35-,36+,37+,38+/m0/s1 |
InChI Key | UQDJDIHBMNWWFP-PRPBYSKFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H58O21 |
Molecular Weight | 850.90 g/mol |
Exact Mass | 850.34705885 g/mol |
Topological Polar Surface Area (TPSA) | 320.00 Ų |
XlogP | -2.50 |
There are no found synonyms. |
![2D Structure of methyl (1S,4aS,6S,7R,7aS)-6-[(2E,6S)-6-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2,6-dimethylocta-2,7-dienoyl]oxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate 2D Structure of methyl (1S,4aS,6S,7R,7aS)-6-[(2E,6S)-6-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2,6-dimethylocta-2,7-dienoyl]oxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/d13fbd40-8535-11ee-b1a1-17dea2f308b0.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.62% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.55% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.77% | 86.92% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.88% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.87% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.87% | 94.73% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.98% | 96.90% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.62% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.06% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.82% | 96.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 87.56% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 87.39% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.20% | 97.25% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.88% | 96.95% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.78% | 91.07% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.53% | 91.24% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.53% | 94.33% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.43% | 95.83% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.87% | 95.71% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.76% | 97.14% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.60% | 97.36% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.54% | 92.50% |
CHEMBL5028 | O14672 | ADAM10 | 83.78% | 97.50% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.41% | 97.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.97% | 100.00% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.87% | 95.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.85% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.02% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.96% | 99.23% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.48% | 95.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.07% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.63% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.14% | 94.45% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 80.13% | 97.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jasminum nervosum |
PubChem | 10724247 |
LOTUS | LTS0119687 |
wikiData | Q105277171 |