2-[[(10R,11S,12R,13R,15R)-3,4,5,13,22,23-hexahydroxy-8,18-dioxo-11,12-bis[(3,4,5-trihydroxybenzoyl)oxy]-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-21-yl]oxy]-3,4,5-trihydroxybenzoic acid
Internal ID | 41f9010a-f8d6-466b-b430-63da124fc4c6 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 2-[[(10R,11S,12R,13R,15R)-3,4,5,13,22,23-hexahydroxy-8,18-dioxo-11,12-bis[(3,4,5-trihydroxybenzoyl)oxy]-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-21-yl]oxy]-3,4,5-trihydroxybenzoic acid |
SMILES (Canonical) | C1C2C(C(C(C(O2)O)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O1)OC7=C(C(=C(C=C7C(=O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O1)OC7=C(C(=C(C=C7C(=O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C41H30O27/c42-14-1-9(2-15(43)24(14)48)37(58)67-34-33-21(65-41(62)35(34)68-38(59)10-3-16(44)25(49)17(45)4-10)8-63-39(60)12-7-20(64-32-13(36(56)57)6-19(47)27(51)31(32)55)28(52)30(54)23(12)22-11(40(61)66-33)5-18(46)26(50)29(22)53/h1-7,21,33-35,41-55,62H,8H2,(H,56,57)/t21-,33-,34+,35-,41-/m1/s1 |
InChI Key | DSHXKESESRMIGQ-RDFPZCOFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H30O27 |
Molecular Weight | 954.70 g/mol |
Exact Mass | 954.09744568 g/mol |
Topological Polar Surface Area (TPSA) | 464.00 Ų |
XlogP | 1.60 |
There are no found synonyms. |
![2D Structure of 2-[[(10R,11S,12R,13R,15R)-3,4,5,13,22,23-hexahydroxy-8,18-dioxo-11,12-bis[(3,4,5-trihydroxybenzoyl)oxy]-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-21-yl]oxy]-3,4,5-trihydroxybenzoic acid 2D Structure of 2-[[(10R,11S,12R,13R,15R)-3,4,5,13,22,23-hexahydroxy-8,18-dioxo-11,12-bis[(3,4,5-trihydroxybenzoyl)oxy]-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-21-yl]oxy]-3,4,5-trihydroxybenzoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/d13db190-8831-11ee-9a56-e3c75b54c3ae.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.11% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.25% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 95.68% | 83.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 95.41% | 94.42% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.89% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.77% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 92.47% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.69% | 99.15% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 91.66% | 97.21% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.61% | 95.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.71% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.34% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.88% | 95.56% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.61% | 83.57% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.18% | 96.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.61% | 95.50% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.63% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.86% | 91.19% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.26% | 90.00% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 81.62% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.32% | 93.00% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 81.00% | 95.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.77% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Coriaria japonica |
Euphorbia prostrata |
Euphorbia thymifolia |
Rosa rugosa |
PubChem | 14704616 |
LOTUS | LTS0085989 |
wikiData | Q104987840 |