(3S)-4-[(2S)-1-[(2S)-1-[(2S)-6-amino-1-[(2S)-6-amino-1-[(2S)-1-[(2S)-1-[(2S)-1-[(2S)-1-[(2S)-6-amino-1-[(2S)-1,4-dihydroxy-1-[(2S)-1-hydroxy-1-[(2S)-1-hydroxy-1-imino-3-phenylpropan-2-yl]imino-4-methylpentan-2-yl]imino-4-iminobutan-2-yl]imino-1-hydroxyhexan-2-yl]imino-1-hydroxy-4-methylpentan-2-yl]imino-1-hydroxy-3-methylbutan-2-yl]imino-1,4-dihydroxy-4-iminobutan-2-yl]imino-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]imino-1-hydroxyhexan-2-yl]imino-1-hydroxyhexan-2-yl]imino-1-hydroxypropan-2-yl]imino-1-hydroxypropan-2-yl]imino-3-[[(2S,3S)-2-[[(2S)-2-[(2-amino-1-hydroxyethylidene)amino]-1-hydroxy-3-methylbutylidene]amino]-1-hydroxy-3-methylpentylidene]amino]-4-hydroxybutanoic acid
| Internal ID | 3ba20877-74dd-4d17-b1f0-1c7fda369f8f |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (3S)-4-[(2S)-1-[(2S)-1-[(2S)-6-amino-1-[(2S)-6-amino-1-[(2S)-1-[(2S)-1-[(2S)-1-[(2S)-1-[(2S)-6-amino-1-[(2S)-1,4-dihydroxy-1-[(2S)-1-hydroxy-1-[(2S)-1-hydroxy-1-imino-3-phenylpropan-2-yl]imino-4-methylpentan-2-yl]imino-4-iminobutan-2-yl]imino-1-hydroxyhexan-2-yl]imino-1-hydroxy-4-methylpentan-2-yl]imino-1-hydroxy-3-methylbutan-2-yl]imino-1,4-dihydroxy-4-iminobutan-2-yl]imino-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]imino-1-hydroxyhexan-2-yl]imino-1-hydroxyhexan-2-yl]imino-1-hydroxypropan-2-yl]imino-1-hydroxypropan-2-yl]imino-3-[[(2S,3S)-2-[[(2S)-2-[(2-amino-1-hydroxyethylidene)amino]-1-hydroxy-3-methylbutylidene]amino]-1-hydroxy-3-methylpentylidene]amino]-4-hydroxybutanoic acid |
| SMILES (Canonical) | CCC(C)C(C(=NC(CC(=O)O)C(=NC(C)C(=NC(C)C(=NC(CCCCN)C(=NC(CCCCN)C(=NC(CC1=CNC2=CC=CC=C21)C(=NC(CC(=N)O)C(=NC(C(C)C)C(=NC(CC(C)C)C(=NC(CCCCN)C(=NC(CC(=N)O)C(=NC(CC(C)C)C(=NC(CC3=CC=CC=C3)C(=N)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N=C(C(C(C)C)N=C(CN)O)O |
| SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=N[C@@H](CC(=O)O)C(=N[C@@H](C)C(=N[C@@H](C)C(=N[C@@H](CCCCN)C(=N[C@@H](CCCCN)C(=N[C@@H](CC1=CNC2=CC=CC=C21)C(=N[C@@H](CC(=N)O)C(=N[C@@H](C(C)C)C(=N[C@@H](CC(C)C)C(=N[C@@H](CCCCN)C(=N[C@@H](CC(=N)O)C(=N[C@@H](CC(C)C)C(=N[C@@H](CC3=CC=CC=C3)C(=N)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N=C([C@H](C(C)C)N=C(CN)O)O |
| InChI | InChI=1S/C86H139N23O20/c1-13-48(10)71(109-85(128)69(46(6)7)107-67(112)42-90)86(129)106-64(41-68(113)114)78(121)96-49(11)73(116)95-50(12)74(117)97-55(29-19-22-32-87)75(118)98-56(30-20-23-33-88)76(119)102-61(38-52-43-94-54-28-18-17-27-53(52)54)81(124)104-63(40-66(92)111)83(126)108-70(47(8)9)84(127)105-60(36-45(4)5)79(122)99-57(31-21-24-34-89)77(120)103-62(39-65(91)110)82(125)101-59(35-44(2)3)80(123)100-58(72(93)115)37-51-25-15-14-16-26-51/h14-18,25-28,43-50,55-64,69-71,94H,13,19-24,29-42,87-90H2,1-12H3,(H2,91,110)(H2,92,111)(H2,93,115)(H,95,116)(H,96,121)(H,97,117)(H,98,118)(H,99,122)(H,100,123)(H,101,125)(H,102,119)(H,103,120)(H,104,124)(H,105,127)(H,106,129)(H,107,112)(H,108,126)(H,109,128)(H,113,114)/t48-,49-,50-,55-,56-,57-,58-,59-,60-,61-,62-,63-,64-,69-,70-,71-/m0/s1 |
| InChI Key | NMYWNRXIMLMQEQ-LNZTUMAESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C86H139N23O20 |
| Molecular Weight | 1815.20 g/mol |
| Exact Mass | 1814.05667392 g/mol |
| Topological Polar Surface Area (TPSA) | 778.00 Ų |
| XlogP | 6.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.55% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.29% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.34% | 91.11% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 96.82% | 90.20% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.43% | 95.56% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 92.63% | 91.71% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 92.56% | 94.08% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 91.92% | 93.18% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.36% | 98.75% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.71% | 94.62% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.57% | 99.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.53% | 96.47% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.55% | 97.21% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.41% | 95.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.23% | 96.95% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.25% | 100.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.09% | 90.24% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 82.08% | 96.37% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.19% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.06% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163192163 |
| LOTUS | LTS0152759 |
| wikiData | Q105182017 |