[(1S,2S,5R,6R,10S,11R,13S,14R,16S)-6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadecan-14-yl] (E)-2-methylbut-2-enoate
Internal ID | b8c147d2-dbde-4b52-8f5d-0c9c82665916 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [(1S,2S,5R,6R,10S,11R,13S,14R,16S)-6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadecan-14-yl] (E)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C2CC3C(CCC4(C3CC(=O)OC4C5=COC=C5)C)C(C2=O)(C(C1(C)C)CC(=O)OC)C |
SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@@H]1[C@@H]2C[C@H]3[C@H](CC[C@@]4([C@H]3CC(=O)O[C@H]4C5=COC=C5)C)[C@](C2=O)([C@H](C1(C)C)CC(=O)OC)C |
InChI | InChI=1S/C32H42O8/c1-8-17(2)29(36)40-28-20-13-19-21(32(6,26(20)35)23(30(28,3)4)15-24(33)37-7)9-11-31(5)22(19)14-25(34)39-27(31)18-10-12-38-16-18/h8,10,12,16,19-23,27-28H,9,11,13-15H2,1-7H3/b17-8+/t19-,20+,21-,22-,23-,27-,28+,31+,32-/m0/s1 |
InChI Key | UEGIMPBBSWHIII-RLDZTJEBSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C32H42O8 |
Molecular Weight | 554.70 g/mol |
Exact Mass | 554.28796829 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 5.00 |
There are no found synonyms. |
![2D Structure of [(1S,2S,5R,6R,10S,11R,13S,14R,16S)-6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadecan-14-yl] (E)-2-methylbut-2-enoate 2D Structure of [(1S,2S,5R,6R,10S,11R,13S,14R,16S)-6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadecan-14-yl] (E)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/d0f01a20-8761-11ee-bf1e-11bab64c35f7.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.90% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.74% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.22% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.24% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.59% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.48% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.70% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.84% | 92.62% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.52% | 93.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.64% | 85.14% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.13% | 97.79% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.11% | 90.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.64% | 100.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.31% | 92.88% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.50% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.31% | 95.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.29% | 99.23% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.93% | 91.24% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.85% | 97.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.48% | 91.19% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.73% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.59% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.40% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Xylocarpus granatum |
PubChem | 162917192 |
LOTUS | LTS0076527 |
wikiData | Q105270893 |