(2S,5S)-4-[2-(19,26-dihydroxy-15-methoxy-7-methyl-3,5,10,17,24-pentaoxo-6-azahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),4(9),7,12,15,18(23),19,21,25-decaen-6-yl)acetyl]-5-methyl-6-oxopiperazine-2-carboxylic acid
| Internal ID | 7a08be6a-d722-4321-aba7-dad73eeb38de |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (2S,5S)-4-[2-(19,26-dihydroxy-15-methoxy-7-methyl-3,5,10,17,24-pentaoxo-6-azahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),4(9),7,12,15,18(23),19,21,25-decaen-6-yl)acetyl]-5-methyl-6-oxopiperazine-2-carboxylic acid |
| SMILES (Canonical) | CC1C(=O)NC(CN1C(=O)CN2C(=CC3=C(C2=O)C(=O)C4=C(C3=O)C=CC5=C4C(=C6C(=C5OC)C(=O)C7=C(C6=O)C=CC=C7O)O)C)C(=O)O |
| SMILES (Isomeric) | C[C@H]1C(=O)N[C@@H](CN1C(=O)CN2C(=CC3=C(C2=O)C(=O)C4=C(C3=O)C=CC5=C4C(=C6C(=C5OC)C(=O)C7=C(C6=O)C=CC=C7O)O)C)C(=O)O |
| InChI | InChI=1S/C35H25N3O12/c1-12-9-17-24(34(47)37(12)11-20(40)38-10-18(35(48)49)36-33(46)13(38)2)30(44)22-15(27(17)41)7-8-16-23(22)31(45)25-26(32(16)50-3)29(43)21-14(28(25)42)5-4-6-19(21)39/h4-9,13,18,39,45H,10-11H2,1-3H3,(H,36,46)(H,48,49)/t13-,18-/m0/s1 |
| InChI Key | PVZIGNWAAPZOSS-UGSOOPFHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H25N3O12 |
| Molecular Weight | 679.60 g/mol |
| Exact Mass | 679.14382324 g/mol |
| Topological Polar Surface Area (TPSA) | 225.00 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.49% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 98.19% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.50% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.64% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.22% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.44% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.51% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.92% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.59% | 99.23% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 92.35% | 92.98% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.05% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.56% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.41% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.15% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.90% | 89.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.60% | 92.94% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 85.17% | 100.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.79% | 98.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.29% | 90.71% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.62% | 91.19% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.93% | 94.45% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 80.70% | 92.68% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.36% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10484684 |
| LOTUS | LTS0085206 |
| wikiData | Q105215682 |