14-[5-Hydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',4',16-triol
Internal ID | 8c0c977a-defa-47d8-b8a2-6f303c67c2e9 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 14-[5-hydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',4',16-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(CO6)O)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)OC19C(C(C(=C)CO9)O)O |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(CO6)O)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)OC19C(C(C(=C)CO9)O)O |
InChI | InChI=1S/C43H66O18/c1-16-13-56-43(37(53)29(16)47)17(2)28-26(61-43)12-23-21-7-6-19-10-20(44)11-27(42(19,5)22(21)8-9-41(23,28)4)58-40-36(60-39-34(52)32(50)30(48)18(3)57-39)35(25(46)15-55-40)59-38-33(51)31(49)24(45)14-54-38/h6,17-18,20-40,44-53H,1,7-15H2,2-5H3 |
InChI Key | BTPXTFRSIGTXMO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H66O18 |
Molecular Weight | 871.00 g/mol |
Exact Mass | 870.42491525 g/mol |
Topological Polar Surface Area (TPSA) | 276.00 Ų |
XlogP | -2.20 |
There are no found synonyms. |
![2D Structure of 14-[5-Hydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',4',16-triol 2D Structure of 14-[5-Hydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',4',16-triol](https://plantaedb.com/storage/docs/compounds/2023/11/d0c16120-8796-11ee-af5b-79fc907d7b55.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.71% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.21% | 95.93% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.86% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.70% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.72% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.70% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.83% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.32% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.63% | 97.09% |
CHEMBL1871 | P10275 | Androgen Receptor | 88.49% | 96.43% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 85.98% | 94.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.89% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.43% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.40% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.58% | 94.45% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.48% | 92.88% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.46% | 94.73% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.41% | 92.94% |
CHEMBL204 | P00734 | Thrombin | 80.42% | 96.01% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.35% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Beaucarnea recurvata |
PubChem | 162847716 |
LOTUS | LTS0120826 |
wikiData | Q104945787 |