(3S,3aS,5aR,6R,9R,9aS,9bS)-3,5a-dimethyl-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,3a,4,5,6,7,8,9,9a,9b-decahydro-2H-benzo[g][1]benzofuran-9-carbaldehyde
| Internal ID | 760e4785-fa86-46f4-afd3-c513c99e528f |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | (3S,3aS,5aR,6R,9R,9aS,9bS)-3,5a-dimethyl-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,3a,4,5,6,7,8,9,9a,9b-decahydro-2H-benzo[g][1]benzofuran-9-carbaldehyde |
| SMILES (Canonical) | CC1COC2C1CCC3(C2C(CCC3OC4C(C(C(C(O4)CO)O)O)O)C=O)C |
| SMILES (Isomeric) | C[C@@H]1CO[C@H]2[C@H]1CC[C@@]3([C@@H]2[C@@H](CC[C@H]3O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C=O)C |
| InChI | InChI=1S/C21H34O8/c1-10-9-27-19-12(10)5-6-21(2)14(4-3-11(7-22)15(19)21)29-20-18(26)17(25)16(24)13(8-23)28-20/h7,10-20,23-26H,3-6,8-9H2,1-2H3/t10-,11+,12+,13-,14-,15-,16-,17+,18-,19+,20+,21+/m1/s1 |
| InChI Key | NHSCYOOZTSLZBS-XOBDASQOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H34O8 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22536804 g/mol |
| Topological Polar Surface Area (TPSA) | 126.00 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.46% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.95% | 95.93% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.54% | 96.61% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.59% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.26% | 96.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 88.62% | 96.43% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.97% | 100.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.80% | 92.50% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 87.71% | 97.47% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.41% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.72% | 98.95% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 86.68% | 98.10% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.41% | 98.75% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.21% | 95.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.66% | 96.47% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 84.22% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.87% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.86% | 95.56% |
| CHEMBL5028 | O14672 | ADAM10 | 81.17% | 97.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.48% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sonchus asper |
| PubChem | 101833771 |
| LOTUS | LTS0209630 |
| wikiData | Q105179568 |