D-Lyxosylamine
| Internal ID | 3051848d-8837-43ea-9dc8-a04ddd34332e |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aldehydes > Beta-hydroxy aldehydes |
| IUPAC Name | 2-amino-3,4,6-trihydroxyhexanal |
| SMILES (Canonical) | C(CO)C(C(C(C=O)N)O)O |
| SMILES (Isomeric) | C(CO)C(C(C(C=O)N)O)O |
| InChI | InChI=1S/C6H13NO4/c7-4(3-9)6(11)5(10)1-2-8/h3-6,8,10-11H,1-2,7H2 |
| InChI Key | JEDHRDQRQUAZDW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08445790 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | -2.70 |
| 39840-37-4 |
| 2-Amino-2,5-dideoxyhexose |
| DTXSID90960402 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.15% | 96.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.39% | 97.29% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.61% | 89.34% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.04% | 90.24% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.64% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.38% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.82% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pogostemon cablin |