D-glucosyl indole-3-carboxylate
Internal ID | 12fda1e7-3bf1-4a3d-a38e-efec4f31e1fc |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolecarboxylic acids and derivatives |
IUPAC Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 1H-indole-3-carboxylate |
SMILES (Canonical) | C1=CC=C2C(=C1)C(=CN2)C(=O)OC3C(C(C(C(O3)CO)O)O)O |
SMILES (Isomeric) | C1=CC=C2C(=C1)C(=CN2)C(=O)OC3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
InChI | InChI=1S/C15H17NO7/c17-6-10-11(18)12(19)13(20)15(22-10)23-14(21)8-5-16-9-4-2-1-3-7(8)9/h1-5,10-13,15-20H,6H2/t10-,11-,12+,13-,15?/m1/s1 |
InChI Key | OQZPHKHJQADXAS-CKMVWSRUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H17NO7 |
Molecular Weight | 323.30 g/mol |
Exact Mass | 323.10050188 g/mol |
Topological Polar Surface Area (TPSA) | 132.00 Ų |
XlogP | 0.40 |
I3CO2Glc |
1-(indol-3-ylcarbonyl)-D-glucose |
1-O-(1H-indol-3-ylcarbonyl)-D-glucopyranose |
SCHEMBL326733 |
CHEBI:65021 |
Q27133584 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.65% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.59% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.05% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.82% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.72% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.61% | 94.73% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 85.10% | 92.67% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.81% | 94.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.41% | 97.09% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 84.38% | 94.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.91% | 89.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.13% | 83.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.75% | 92.62% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.06% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arabidopsis thaliana |
PubChem | 66655952 |
LOTUS | LTS0109692 |
wikiData | Q27133584 |