D-Altrose
| Internal ID | 80853173-5d5f-4530-803a-56ec4e624f91 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Monosaccharides > Hexoses |
| IUPAC Name | (3S,4R,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES (Canonical) | C(C1C(C(C(C(O1)O)O)O)O)O |
| SMILES (Isomeric) | C([C@@H]1[C@H]([C@H]([C@@H](C(O1)O)O)O)O)O |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4-,5+,6?/m1/s1 |
| InChI Key | WQZGKKKJIJFFOK-RSVSWTKNSA-N |
| Popularity | 242 references in papers |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 110.00 Ų |
| XlogP | -2.60 |
| D-Altropyranose |
| D-Altropyranoside |
| D-Altrose |
| D-altro-hexopyranose |
| SCHEMBL79549 |
| (3S,4R,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| CHEBI:149545 |
| C06464 |
| WURCS=2.0/1,1,0/[a1222h-1x_1-5]/1/ |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL226 | P30542 | Adenosine A1 receptor | 91.94% | 95.93% |
| CHEMBL3589 | P55263 | Adenosine kinase | 88.61% | 98.05% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.29% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.25% | 91.11% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.54% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pogostemon cablin |