Cytorhizin D
| Internal ID | a7c6bcaf-e732-44a0-b149-2d794a876c03 |
| Taxonomy | Organoheterocyclic compounds > Benzoxepines > Dibenzoxepines |
| IUPAC Name | [(1R,9R,17R,20R)-7,9,11-trihydroxy-13,16,16,20-tetramethyl-2,15,18-trioxapentacyclo[8.8.1.11,9.03,8.014,19]icosa-3,5,7,10,12,14(19)-hexaen-17-yl]methyl acetate |
| SMILES (Canonical) | CC1C2(C3=C(C=CC=C3OC14C5=C(C(=CC(=C52)O)C)OC(C(O4)COC(=O)C)(C)C)O)O |
| SMILES (Isomeric) | C[C@@H]1[C@@]2(C3=C(C=CC=C3O[C@@]14C5=C(C(=CC(=C52)O)C)OC([C@H](O4)COC(=O)C)(C)C)O)O |
| InChI | InChI=1S/C24H26O8/c1-11-9-15(27)19-20-21(11)32-22(4,5)17(10-29-13(3)25)31-24(20)12(2)23(19,28)18-14(26)7-6-8-16(18)30-24/h6-9,12,17,26-28H,10H2,1-5H3/t12-,17-,23+,24+/m1/s1 |
| InChI Key | NTLDKJCPDFLPTP-ZXKSQTTKSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.16276778 g/mol |
| Topological Polar Surface Area (TPSA) | 115.00 Ų |
| XlogP | 2.40 |
| [(1R,9R,17R,20R)-7,9,11-trihydroxy-13,16,16,20-tetramethyl-2,15,18-trioxapentacyclo[8.8.1.11,9.03,8.014,19]icosa-3,5,7,10,12,14(19)-hexaen-17-yl]methyl acetate |
| ((1R,9R,17R,20R)-7,9,11-Trihydroxy-13,16,16,20-tetramethyl-2,15,18-trioxapentacyclo(8.8.1.1,.0,.0,)icosa-3,5,7,10,12,14(19)-hexaen-17-yl)methyl acetic acid |
| ((1R,9R,17R,20R)-7,9,11-trihydroxy-13,16,16,20-tetramethyl-2,15,18-trioxapentacyclo(8.8.1.11,9.03,8.014,19)icosa-3,5,7,10,12,14(19)-hexaen-17-yl)methyl acetate |
| [(1R,9R,17R,20R)-7,9,11-Trihydroxy-13,16,16,20-tetramethyl-2,15,18-trioxapentacyclo[8.8.1.1,.0,.0,]icosa-3,5,7,10,12,14(19)-hexaen-17-yl]methyl acetic acid |
| RefChem:130385 |
| CHEBI:209470 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.09% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.62% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.19% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.77% | 86.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 93.31% | 96.95% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.36% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.55% | 91.49% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.42% | 94.80% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.80% | 89.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 85.25% | 83.82% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.14% | 95.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.10% | 97.21% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.00% | 99.15% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.45% | 95.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.49% | 99.23% |
| CHEMBL5028 | O14672 | ADAM10 | 80.25% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683155 |
| LOTUS | LTS0043793 |
| wikiData | Q105185497 |