Cyrneine C
| Internal ID | d7466277-0479-4888-936c-687318e49ea5 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | (3aR,5aR,10aR,10bR)-3a,5a-dimethyl-3,6-dioxo-1-propan-2-yl-4,5,7,10,10a,10b-hexahydrocyclohepta[e]indene-8-carbaldehyde |
| SMILES (Canonical) | CC(C)C1=CC(=O)C2(C1C3CC=C(CC(=O)C3(CC2)C)C=O)C |
| SMILES (Isomeric) | CC(C)C1=CC(=O)[C@]2([C@@H]1[C@H]3CC=C(CC(=O)[C@@]3(CC2)C)C=O)C |
| InChI | InChI=1S/C20H26O3/c1-12(2)14-10-17(23)20(4)8-7-19(3)15(18(14)20)6-5-13(11-21)9-16(19)22/h5,10-12,15,18H,6-9H2,1-4H3/t15-,18+,19-,20+/m1/s1 |
| InChI Key | UVDJGUGLTDSECX-NMLACTOBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18819469 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 2.30 |
| (3aR,5aR,10aR,10bR)-3a,5a-dimethyl-3,6-dioxo-1-propan-2-yl-4,5,7,10,10a,10b-hexahydrocyclohepta[e]indene-8-carbaldehyde |
| (3aR,5aR,10aR,10bR)-3a,5a-dimethyl-3,6-dioxo-1-propan-2-yl-4,5,7,10,10a,10b-hexahydrocyclohepta(e)indene-8-carbaldehyde |
| RefChem:130171 |
| CHEMBL389224 |
| CHEBI:198662 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.35% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.24% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.85% | 94.75% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 92.90% | 85.30% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.76% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.40% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.22% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.75% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.06% | 82.69% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.57% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.49% | 90.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.53% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.87% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16739359 |
| LOTUS | LTS0130030 |
| wikiData | Q75062649 |